The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(6-(2-ethyl-3-oxo-6-((1,2,3,4-tetrahydroisoquinolin-6-yl)amino)-2,3-dihydro-1H-pyrazolo[3,4-d]pyrimidin-1-yl)pyridin-2-yl)cyclopropane-1-carbonitrile ID: ALA4878169
PubChem CID: 155191080
Max Phase: Preclinical
Molecular Formula: C25H24N8O
Molecular Weight: 452.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2n1-c1cccc(C2(C#N)CC2)n1
Standard InChI: InChI=1S/C25H24N8O/c1-2-32-23(34)19-14-28-24(29-18-7-6-17-13-27-11-8-16(17)12-18)31-22(19)33(32)21-5-3-4-20(30-21)25(15-26)9-10-25/h3-7,12,14,27H,2,8-11,13H2,1H3,(H,28,29,31)
Standard InChI Key: FPQGOOJFBPSPIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
16.4965 -9.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0921 -10.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9091 -10.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -7.5410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6054 -7.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3137 -7.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3137 -8.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6080 -8.7664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1893 -8.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4813 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7730 -8.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -8.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -7.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7704 -7.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4813 -7.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3560 -7.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6476 -7.5458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6476 -8.3656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3560 -8.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0897 -8.6013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5771 -7.9434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1116 -7.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3237 -6.5010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3018 -9.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0938 -9.6057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3039 -10.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7238 -10.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9369 -10.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7225 -9.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3942 -7.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8086 -7.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3040 -11.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5130 -12.1836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 2 0
4 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
13 20 1 0
7 21 1 0
21 22 1 0
23 22 1 0
6 23 1 0
23 24 2 0
25 21 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
22 31 1 0
31 32 1 0
27 2 1 0
2 33 1 0
33 34 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.52Molecular Weight (Monoisotopic): 452.2073AlogP: 2.94#Rotatable Bonds: 5Polar Surface Area: 113.45Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.70CX Basic pKa: 9.10CX LogP: 2.75CX LogD: 1.05Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -1.01
References 1. (2020) Heterocyclic compounds and uses thereof,