The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(4-(1H-imidazol-1-yl)phenyl)-5-(4-(dimethylamino)phenyl)-4,5-dihydro-1H-pyrazol-1-ylsulfonyl)benzonitrile ID: ALA4878170
PubChem CID: 164627303
Max Phase: Preclinical
Molecular Formula: C27H24N6O2S
Molecular Weight: 496.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(C2CC(c3ccc(-n4ccnc4)cc3)=NN2S(=O)(=O)c2ccc(C#N)cc2)cc1
Standard InChI: InChI=1S/C27H24N6O2S/c1-31(2)23-9-7-22(8-10-23)27-17-26(21-5-11-24(12-6-21)32-16-15-29-19-32)30-33(27)36(34,35)25-13-3-20(18-28)4-14-25/h3-16,19,27H,17H2,1-2H3
Standard InChI Key: LDYHDQFWPWNLKK-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
26.2203 -18.9275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9302 -18.5230 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.2249 -18.1105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1549 -19.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8152 -20.4428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4783 -19.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2266 -19.1848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4103 -19.1864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2523 -20.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4187 -21.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1943 -21.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8042 -20.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6333 -19.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8579 -19.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3783 -20.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7727 -19.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9953 -19.9105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8225 -20.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4331 -21.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2080 -21.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0449 -20.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4385 -20.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8737 -21.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5810 -20.9845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2640 -17.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0744 -17.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4082 -16.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9303 -16.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1147 -16.3781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7846 -17.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2637 -15.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5942 -14.7989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8327 -21.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6499 -21.7592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9038 -20.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2434 -20.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
6 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
4 15 1 0
18 21 1 0
21 22 1 0
21 23 1 0
12 24 1 0
8 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 3 0
24 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.60Molecular Weight (Monoisotopic): 496.1681AlogP: 4.35#Rotatable Bonds: 6Polar Surface Area: 94.59Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.08CX LogP: 4.24CX LogD: 4.22Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.93
References 1. Chen CH, Jiang Y, Wu R, Tang Y, Wan C, Gao H, Mao Z.. (2021) Discovery of heterocyclic substituted dihydropyrazoles as potent anticancer agents., 48 [PMID:34214509 ] [10.1016/j.bmcl.2021.128233 ]