4-(4-(2-Fluorophenyl)piperazin-1-yl)-6,7-bis(2-methoxyethoxy)quinazoline

ID: ALA4878172

PubChem CID: 164627304

Max Phase: Preclinical

Molecular Formula: C24H29FN4O4

Molecular Weight: 456.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCOc1cc2ncnc(N3CCN(c4ccccc4F)CC3)c2cc1OCCOC

Standard InChI:  InChI=1S/C24H29FN4O4/c1-30-11-13-32-22-15-18-20(16-23(22)33-14-12-31-2)26-17-27-24(18)29-9-7-28(8-10-29)21-6-4-3-5-19(21)25/h3-6,15-17H,7-14H2,1-2H3

Standard InChI Key:  JBSDMTQQPDANCV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   20.9855  -29.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9844  -29.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6924  -30.2676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6907  -28.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3993  -29.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4000  -29.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1086  -30.2616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8168  -29.8508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8121  -29.0287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1030  -28.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0987  -27.8081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2777  -28.6307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5701  -29.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8623  -28.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1547  -29.0398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4469  -28.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2764  -30.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5690  -29.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8609  -30.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1536  -29.8564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4455  -30.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8046  -27.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8023  -26.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0942  -26.1789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3869  -26.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3876  -27.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0930  -25.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7994  -24.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7985  -24.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0897  -23.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3803  -24.1462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3846  -24.9612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6799  -25.3749    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 11 22  1  0
 11 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878172

    ---

Associated Targets(Human)

KDM1A Tchem Lysine-specific histone demethylase 1 (3916 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.52Molecular Weight (Monoisotopic): 456.2173AlogP: 3.15#Rotatable Bonds: 10
Polar Surface Area: 69.18Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.33CX LogP: 3.60CX LogD: 3.60
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.31

References

1. Li Z, Qin T, Li Z, Zhao X, Zhang X, Zhao T, Yang N, Miao J, Ma J, Zhang Z..  (2021)  Discovery of quinazoline derivatives as a novel class of potent and in vivo efficacious LSD1 inhibitors by drug repurposing.,  225  [PMID:34416665] [10.1016/j.ejmech.2021.113778]

Source