The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(2-Fluorophenyl)piperazin-1-yl)-6,7-bis(2-methoxyethoxy)quinazoline ID: ALA4878172
PubChem CID: 164627304
Max Phase: Preclinical
Molecular Formula: C24H29FN4O4
Molecular Weight: 456.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCOc1cc2ncnc(N3CCN(c4ccccc4F)CC3)c2cc1OCCOC
Standard InChI: InChI=1S/C24H29FN4O4/c1-30-11-13-32-22-15-18-20(16-23(22)33-14-12-31-2)26-17-27-24(18)29-9-7-28(8-10-29)21-6-4-3-5-19(21)25/h3-6,15-17H,7-14H2,1-2H3
Standard InChI Key: JBSDMTQQPDANCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
20.9855 -29.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9844 -29.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6924 -30.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6907 -28.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3993 -29.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4000 -29.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1086 -30.2616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8168 -29.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8121 -29.0287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1030 -28.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0987 -27.8081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2777 -28.6307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5701 -29.0395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8623 -28.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1547 -29.0398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4469 -28.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2764 -30.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5690 -29.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8609 -30.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1536 -29.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4455 -30.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8046 -27.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8023 -26.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0942 -26.1789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3869 -26.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3876 -27.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0930 -25.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7994 -24.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7985 -24.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0897 -23.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3803 -24.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3846 -24.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6799 -25.3749 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
1 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
2 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
11 22 1 0
11 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.52Molecular Weight (Monoisotopic): 456.2173AlogP: 3.15#Rotatable Bonds: 10Polar Surface Area: 69.18Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.33CX LogP: 3.60CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.31
References 1. Li Z, Qin T, Li Z, Zhao X, Zhang X, Zhao T, Yang N, Miao J, Ma J, Zhang Z.. (2021) Discovery of quinazoline derivatives as a novel class of potent and in vivo efficacious LSD1 inhibitors by drug repurposing., 225 [PMID:34416665 ] [10.1016/j.ejmech.2021.113778 ]