((5-(2-(Piperazin-1-yl)ethoxy)pyrazine-2,3-diyl)bis(4,1-phenylene))dimethanamine

ID: ALA4878235

PubChem CID: 164628304

Max Phase: Preclinical

Molecular Formula: C24H30N6O

Molecular Weight: 418.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(-c2ncc(OCCN3CCNCC3)nc2-c2ccc(CN)cc2)cc1

Standard InChI:  InChI=1S/C24H30N6O/c25-15-18-1-5-20(6-2-18)23-24(21-7-3-19(16-26)4-8-21)29-22(17-28-23)31-14-13-30-11-9-27-10-12-30/h1-8,17,27H,9-16,25-26H2

Standard InChI Key:  XLMCBBNVJVEWBU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   17.6301  -27.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6290  -28.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3370  -28.9057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0467  -28.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0438  -27.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3352  -27.2683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7550  -28.9037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4621  -28.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1704  -28.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9228  -28.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2152  -28.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5076  -28.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5065  -29.7196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2189  -30.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9235  -29.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9244  -27.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9255  -26.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2185  -26.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5099  -26.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5128  -27.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2203  -27.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7990  -30.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0911  -29.7203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8016  -26.0436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0945  -26.4533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8775  -28.4918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5858  -28.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8762  -27.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5833  -27.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2916  -27.6724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2929  -28.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
 13 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
  9 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 27 31  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878235

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.55Molecular Weight (Monoisotopic): 418.2481AlogP: 2.01#Rotatable Bonds: 8
Polar Surface Area: 102.32Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.69CX LogP: 1.78CX LogD: -3.61
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -0.76

References

1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y..  (2021)  Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease.,  64  (5.0): [PMID:33596380] [10.1021/acs.jmedchem.0c02070]

Source