NA

ID: ALA4878281

PubChem CID: 164628751

Max Phase: Preclinical

Molecular Formula: C28H29ClN4O4

Molecular Weight: 484.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=C(N[C@@H]1C=C[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3CC2CC2)[C@H]1O5)c1n[nH]c2ccccc12

Standard InChI:  InChI=1S/C28H28N4O4.ClH/c33-20-8-7-16-13-21-28(35)10-9-19(29-26(34)23-17-3-1-2-4-18(17)30-31-23)25-27(28,22(16)24(20)36-25)11-12-32(21)14-15-5-6-15;/h1-4,7-10,15,19,21,25,33,35H,5-6,11-14H2,(H,29,34)(H,30,31);1H/t19-,21-,25+,27+,28-;/m1./s1

Standard InChI Key:  GSSMUVMDVOHBMO-QTJUMRCSSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
    7.6607  -23.2179    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.0830  -20.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2638  -20.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4989  -19.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8647  -21.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4863  -21.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6377  -21.7612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621  -19.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8647  -19.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3182  -19.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2638  -19.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0830  -18.3290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6630  -19.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7298  -20.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3098  -21.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0414  -21.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6630  -18.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0414  -19.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6254  -20.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6170  -21.9966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7172  -22.0049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4948  -17.6023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4821  -22.1940    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9107  -19.1399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7721  -18.7408    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5491  -22.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9594  -22.7347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9704  -21.2941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3266  -17.5955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0471  -18.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0403  -17.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6198  -23.4905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2337  -24.0517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7904  -22.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9532  -23.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7359  -23.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3566  -23.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1893  -22.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4067  -22.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  2  1  0
  5  3  2  0
  6  2  1  0
  7  6  1  0
  8  4  1  0
  9  3  1  0
 10  4  1  0
 11  8  1  0
 12 17  1  0
  2 13  1  1
 14 15  1  0
 15  6  1  0
 16  5  1  0
 17 13  1  0
 18  9  2  0
 19 18  1  0
 20 16  1  0
 15 21  1  1
 22 12  1  0
  6 23  1  1
  4 24  1  1
  8 25  1  6
  7  5  1  0
 12  8  1  0
 14 10  2  0
 11  9  1  0
 16 19  2  0
 21 26  1  0
 26 27  1  0
 26 28  2  0
 22 29  1  0
 30 29  1  0
 31 30  1  0
 29 31  1  0
 27 32  2  0
 32 33  1  0
 33 35  1  0
 34 27  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Associated Targets(Human)

OPRM1 Tclin Mu opioid receptor (19785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.56Molecular Weight (Monoisotopic): 484.2111AlogP: 2.41#Rotatable Bonds: 4
Polar Surface Area: 110.71Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.88CX Basic pKa: 9.35CX LogP: 1.75CX LogD: 0.34
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.42Np Likeness Score: 0.56

References

1. Ma H, Wang H, Gillespie JC, Mendez RE, Selley DE, Zhang Y..  (2021)  Exploring naltrexamine derivatives featuring azaindole moiety via nitrogen-walk approach to investigate their in vitro pharmacological profiles at the mu opioid receptor.,  41  [PMID:33766769] [10.1016/j.bmcl.2021.127953]

Source