The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2,5-dimethoxyphenyl)-7,7-dimethyl-3-(3-phenyl-1H-pyrazol-1-yl)-7,8-dihydroquinoline-2,5(1H,6H)-dione ID: ALA4878331
PubChem CID: 137548064
Max Phase: Preclinical
Molecular Formula: C28H27N3O4
Molecular Weight: 469.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(-n2c3c(cc(-n4ccc(-c5ccccc5)n4)c2=O)C(=O)CC(C)(C)C3)c1
Standard InChI: InChI=1S/C28H27N3O4/c1-28(2)16-24-20(25(32)17-28)15-23(30-13-12-21(29-30)18-8-6-5-7-9-18)27(33)31(24)22-14-19(34-3)10-11-26(22)35-4/h5-15H,16-17H2,1-4H3
Standard InChI Key: JOHWMKTUNPFABA-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
35.2323 -4.2545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6490 -3.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8236 -3.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6490 -2.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3611 -3.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3611 -2.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0732 -2.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0696 -3.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7785 -3.9553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.4954 -3.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4989 -2.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7855 -2.3051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3611 -1.4751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2076 -3.9646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7740 -4.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0555 -5.1869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0505 -6.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7633 -6.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4824 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4839 -5.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3437 -4.7696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6264 -5.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1961 -6.4296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1944 -7.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2106 -2.3152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9625 -2.6548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5178 -2.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1090 -1.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3012 -1.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3352 -2.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6659 -2.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4853 -2.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9746 -2.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6388 -1.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8205 -1.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 6 1 0
2 5 1 0
5 8 1 0
7 6 1 0
7 8 2 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
6 13 2 0
10 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
9 15 1 0
16 21 1 0
21 22 1 0
19 23 1 0
23 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 25 1 0
11 25 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.54Molecular Weight (Monoisotopic): 469.2002AlogP: 4.86#Rotatable Bonds: 5Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.40CX LogP: 4.63CX LogD: 4.63Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -0.93
References 1. Rohde JM, Karavadhi S, Pragani R, Liu L, Fang Y, Zhang W, McIver A, Zheng H, Liu Q, Davis MI, Urban DJ, Lee TD, Cheff DM, Hollingshead M, Henderson MJ, Martinez NJ, Brimacombe KR, Yasgar A, Zhao W, Klumpp-Thomas C, Michael S, Covey J, Moore WJ, Stott GM, Li Z, Simeonov A, Jadhav A, Frye S, Hall MD, Shen M, Wang X, Patnaik S, Boxer MB.. (2021) Discovery and Optimization of 2H -1λ2 -Pyridin-2-one Inhibitors of Mutant Isocitrate Dehydrogenase 1 for the Treatment of Cancer., 64 (8.0): [PMID:33822623 ] [10.1021/acs.jmedchem.1c00019 ]