The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl (4,9-dioxo-2-(3,4,5-trimethoxyphenyl)-4,9-dihydrofuro[2,3-g]quinolin-3-yl)phosphonate ID: ALA4878354
PubChem CID: 164626653
Max Phase: Preclinical
Molecular Formula: C24H24NO9P
Molecular Weight: 501.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)c1c(-c2cc(OC)c(OC)c(OC)c2)oc2c1C(=O)c1ncccc1C2=O
Standard InChI: InChI=1S/C24H24NO9P/c1-6-32-35(28,33-7-2)24-17-20(27)18-14(9-8-10-25-18)19(26)23(17)34-21(24)13-11-15(29-3)22(31-5)16(12-13)30-4/h8-12H,6-7H2,1-5H3
Standard InChI Key: MDRYGHYASPHLJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
23.3215 -8.1496 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
24.1023 -8.4044 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9292 -7.5987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4115 -9.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4103 -10.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1244 -10.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1226 -8.7905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8372 -9.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8407 -10.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5591 -10.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5523 -8.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5477 -7.9537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5613 -11.2663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2753 -9.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2770 -10.0277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0712 -10.2839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5603 -9.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0683 -8.9339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7687 -7.5382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7552 -6.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3659 -6.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7154 -7.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4105 -8.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3844 -9.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7928 -10.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6162 -10.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0276 -9.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6096 -8.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7875 -8.8921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0208 -8.1701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8516 -9.6012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0288 -11.0332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8449 -8.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2648 -10.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6164 -11.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 15 1 0
14 11 1 0
11 12 2 0
10 13 2 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
18 1 1 0
1 19 2 0
3 20 1 0
20 21 1 0
2 22 1 0
22 23 1 0
17 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
27 31 1 0
26 32 1 0
30 33 1 0
31 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.43Molecular Weight (Monoisotopic): 501.1189AlogP: 4.03#Rotatable Bonds: 9Polar Surface Area: 123.39Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.11CX LogP: 1.74CX LogD: 1.74Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: 0.35
References 1. Modranka J, Drogosz-Stachowicz J, Pietrzak A, Janecka A, Janecki T.. (2021) Synthesis and structure-activity relationship study of novel 3-diethoxyphosphorylfuroquinoline-4,9-diones with potent antitumor efficacy., 219 [PMID:33852973 ] [10.1016/j.ejmech.2021.113429 ]