The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(2-chlorobenzyl)-N2-(2-(1-(phenylsulfonyl)-1H-indol-4-yloxy)ethyl)ethane-1,2-diamine ID: ALA4878383
PubChem CID: 164627505
Max Phase: Preclinical
Molecular Formula: C25H26ClN3O3S
Molecular Weight: 484.02
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccccc1)n1ccc2c(OCCNCCNCc3ccccc3Cl)cccc21
Standard InChI: InChI=1S/C25H26ClN3O3S/c26-23-10-5-4-7-20(23)19-28-15-14-27-16-18-32-25-12-6-11-24-22(25)13-17-29(24)33(30,31)21-8-2-1-3-9-21/h1-13,17,27-28H,14-16,18-19H2
Standard InChI Key: ZQCBFXXNIMDVLV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.8713 -6.4302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1656 -6.0216 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1646 -6.8371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8381 -3.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8370 -4.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2518 -3.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5432 -2.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2547 -4.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5479 -4.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7155 -5.4193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5259 -5.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8591 -4.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3683 -5.8535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1196 -5.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3215 -4.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7724 -5.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0269 -6.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8244 -6.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9580 -2.9818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6673 -3.3877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3734 -2.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0827 -3.3824 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7888 -2.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4981 -3.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2042 -2.9658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9135 -3.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6148 -2.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3219 -3.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0219 -2.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0160 -2.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3042 -1.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6071 -2.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3274 -4.1767 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 9 1 0
8 6 1 0
6 7 2 0
7 4 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
10 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
6 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
28 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.02Molecular Weight (Monoisotopic): 483.1383AlogP: 4.29#Rotatable Bonds: 11Polar Surface Area: 72.36Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.78CX LogP: 4.44CX LogD: 3.04Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -1.27
References 1. Wichur T, Pasieka A, Godyń J, Panek D, Góral I, Latacz G, Honkisz-Orzechowska E, Bucki A, Siwek A, Głuch-Lutwin M, Knez D, Brazzolotto X, Gobec S, Kołaczkowski M, Sabate R, Malawska B, Więckowska A.. (2021) Discovery of 1-(phenylsulfonyl)-1H-indole-based multifunctional ligands targeting cholinesterases and 5-HT6 receptor with anti-aggregation properties against amyloid-beta and tau., 225 [PMID:34461507 ] [10.1016/j.ejmech.2021.113783 ]