The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-methoxy-N-(2-((2-((1-(4-methoxyphenyl)ethyl)amino)-2-oxoethyl)thio)benzo[d]thiazol-6-yl)-3-methyl-4-(2-morpholinoethoxy)benzamide ID: ALA4878402
PubChem CID: 164627787
Max Phase: Preclinical
Molecular Formula: C33H38N4O6S2
Molecular Weight: 650.82
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@H](C)NC(=O)CSc2nc3ccc(NC(=O)c4ccc(OCCN5CCOCC5)c(C)c4OC)cc3s2)cc1
Standard InChI: InChI=1S/C33H38N4O6S2/c1-21-28(43-18-15-37-13-16-42-17-14-37)12-10-26(31(21)41-4)32(39)35-24-7-11-27-29(19-24)45-33(36-27)44-20-30(38)34-22(2)23-5-8-25(40-3)9-6-23/h5-12,19,22H,13-18,20H2,1-4H3,(H,34,38)(H,35,39)/t22-/m0/s1
Standard InChI Key: NTFBXCAMUASLBS-QFIPXVFZSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
25.3181 -26.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3169 -27.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0294 -27.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7478 -27.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7449 -26.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0276 -26.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0251 -25.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7403 -24.8934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3117 -24.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4579 -25.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1730 -24.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8906 -25.3024 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.6057 -24.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3587 -25.2179 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.6858 -24.0593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4938 -23.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9028 -24.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7257 -24.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1404 -23.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7223 -23.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9008 -23.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9670 -23.8864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3791 -24.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2056 -24.6012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6182 -25.3201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4439 -25.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8551 -24.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4386 -23.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6142 -23.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6816 -24.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4603 -26.1331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9688 -25.3191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.0946 -25.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9170 -25.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3300 -26.0201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8472 -23.1702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1999 -23.1775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6081 -22.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9182 -26.7294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3277 -27.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1504 -27.4406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5620 -26.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1508 -26.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0281 -28.6159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3153 -29.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
7 9 1 6
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 17 1 0
16 15 1 0
15 13 2 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
10 31 2 0
23 32 2 0
30 33 1 0
33 34 1 0
34 35 1 0
28 36 1 0
29 37 1 0
37 38 1 0
35 39 1 0
35 43 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
3 44 1 0
44 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 650.82Molecular Weight (Monoisotopic): 650.2233AlogP: 5.55#Rotatable Bonds: 13Polar Surface Area: 111.25Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.48CX Basic pKa: 6.36CX LogP: 5.08CX LogD: 5.04Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.18Np Likeness Score: -1.90
References 1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y.. (2021) Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors., 216 [PMID:33689932 ] [10.1016/j.ejmech.2021.113333 ]