The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N5-((1R,5S,6r)-3-oxabicyclo[3.1.0]hexan-6-yl)-3-ethyl-N7-methyl-3-phenyl-2,3-dihydrobenzofuran-5,7-dicarboxamide ID: ALA4878419
PubChem CID: 142553672
Max Phase: Preclinical
Molecular Formula: C24H26N2O4
Molecular Weight: 406.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(c2ccccc2)COc2c(C(=O)NC)cc(C(=O)N[C@H]3[C@@H]4COC[C@@H]43)cc21
Standard InChI: InChI=1S/C24H26N2O4/c1-3-24(15-7-5-4-6-8-15)13-30-21-16(23(28)25-2)9-14(10-19(21)24)22(27)26-20-17-11-29-12-18(17)20/h4-10,17-18,20H,3,11-13H2,1-2H3,(H,25,28)(H,26,27)/t17-,18+,20+,24-/m0/s1
Standard InChI Key: WHXNIGTVSQUAGO-UOUMEPNKSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
22.7369 -4.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7410 -4.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0313 -4.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2266 -4.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9362 -3.9062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9334 -3.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2248 -2.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2223 -1.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9288 -1.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5134 -1.4546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5110 -0.6374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6446 -4.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6459 -5.1309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3516 -3.9040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0600 -4.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5185 -3.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5197 -3.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7435 -2.8366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2625 -3.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8787 -4.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4712 -5.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0230 -5.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7716 -5.2861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6823 -4.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7610 -5.4191 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
28.0858 -3.5081 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.0248 -5.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0204 -6.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7265 -6.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4387 -6.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4397 -5.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3256 -4.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
16 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 17 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
5 12 1 0
12 13 2 0
12 14 1 0
15 14 1 1
21 15 1 0
15 20 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 2 1 0
2 16 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
21 25 1 1
20 26 1 1
1 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 1 1 0
3 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.48Molecular Weight (Monoisotopic): 406.1893AlogP: 2.51#Rotatable Bonds: 5Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.39CX Basic pKa: ┄CX LogP: 1.89CX LogD: 1.89Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.80Np Likeness Score: -0.02
References 1. Lucas SCC, Atkinson SJ, Chung CW, Davis R, Gordon L, Grandi P, Gray JJR, Grimes T, Phillipou A, Preston AG, Prinjha RK, Rioja I, Taylor S, Tomkinson NCO, Wall I, Watson RJ, Woolven J, Demont EH.. (2021) Optimization of a Series of 2,3-Dihydrobenzofurans as Highly Potent, Second Bromodomain (BD2)-Selective, Bromo and Extra-Terminal Domain (BET) Inhibitors., 64 (15.0): [PMID:34260229 ] [10.1021/acs.jmedchem.1c00344 ]