(S)-N5-((1R,5S,6r)-3-oxabicyclo[3.1.0]hexan-6-yl)-3-ethyl-N7-methyl-3-phenyl-2,3-dihydrobenzofuran-5,7-dicarboxamide

ID: ALA4878419

PubChem CID: 142553672

Max Phase: Preclinical

Molecular Formula: C24H26N2O4

Molecular Weight: 406.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]1(c2ccccc2)COc2c(C(=O)NC)cc(C(=O)N[C@H]3[C@@H]4COC[C@@H]43)cc21

Standard InChI:  InChI=1S/C24H26N2O4/c1-3-24(15-7-5-4-6-8-15)13-30-21-16(23(28)25-2)9-14(10-19(21)24)22(27)26-20-17-11-29-12-18(17)20/h4-10,17-18,20H,3,11-13H2,1-2H3,(H,25,28)(H,26,27)/t17-,18+,20+,24-/m0/s1

Standard InChI Key:  WHXNIGTVSQUAGO-UOUMEPNKSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   22.7369   -4.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7410   -4.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0313   -4.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2266   -4.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9362   -3.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9334   -3.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2248   -2.6783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2223   -1.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9288   -1.4504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5134   -1.4546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5110   -0.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6446   -4.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6459   -5.1309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3516   -3.9040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0600   -4.3115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5185   -3.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5197   -3.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7435   -2.8366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2625   -3.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8787   -4.3027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4712   -5.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0230   -5.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7716   -5.2861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6823   -4.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7610   -5.4191    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.0858   -3.5081    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.0248   -5.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0204   -6.1929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7265   -6.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4387   -6.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4397   -5.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3256   -4.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
 16  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7 17  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
  5 12  1  0
 12 13  2  0
 12 14  1  0
 15 14  1  1
 21 15  1  0
 15 20  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19  2  1  0
  2 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 21 25  1  1
 20 26  1  1
  1 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  1  1  0
  3 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878419

    ---

Associated Targets(Human)

BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.48Molecular Weight (Monoisotopic): 406.1893AlogP: 2.51#Rotatable Bonds: 5
Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.39CX Basic pKa: CX LogP: 1.89CX LogD: 1.89
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.80Np Likeness Score: -0.02

References

1. Lucas SCC, Atkinson SJ, Chung CW, Davis R, Gordon L, Grandi P, Gray JJR, Grimes T, Phillipou A, Preston AG, Prinjha RK, Rioja I, Taylor S, Tomkinson NCO, Wall I, Watson RJ, Woolven J, Demont EH..  (2021)  Optimization of a Series of 2,3-Dihydrobenzofurans as Highly Potent, Second Bromodomain (BD2)-Selective, Bromo and Extra-Terminal Domain (BET) Inhibitors.,  64  (15.0): [PMID:34260229] [10.1021/acs.jmedchem.1c00344]

Source