The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-Cyanoethyl)-N-(2,2-diphenylethyl)-1,5-dimethyl-6-oxo-1,6-dihydropyridine-3-carboxamide ID: ALA4878445
PubChem CID: 164628323
Max Phase: Preclinical
Molecular Formula: C25H25N3O2
Molecular Weight: 399.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C(=O)N(CC(c2ccccc2)c2ccccc2)C(C)C#N)cn(C)c1=O
Standard InChI: InChI=1S/C25H25N3O2/c1-18-14-22(16-27(3)24(18)29)25(30)28(19(2)15-26)17-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-14,16,19,23H,17H2,1-3H3
Standard InChI Key: HGEYBNIOHKEYAV-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
30.2347 -10.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2335 -11.6947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9416 -12.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6512 -11.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6484 -10.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9398 -10.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5269 -10.4668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9373 -9.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3596 -12.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3609 -12.9189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0666 -11.6921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7744 -12.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0182 -12.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8161 -13.0492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4663 -13.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6688 -13.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1172 -13.8960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3630 -14.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1655 -14.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7137 -14.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0589 -13.8275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8559 -14.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4088 -13.4014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1590 -12.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3626 -12.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5255 -12.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0657 -10.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7729 -10.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3575 -10.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4748 -10.0554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 2 0
6 8 1 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
14 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 14 1 0
2 26 1 0
11 27 1 0
27 28 1 0
27 29 1 0
28 30 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.49Molecular Weight (Monoisotopic): 399.1947AlogP: 3.88#Rotatable Bonds: 6Polar Surface Area: 66.10Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.33CX LogD: 3.33Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.82
References 1. Rianjongdee F, Atkinson SJ, Chung CW, Grandi P, Gray JRJ, Kaushansky LJ, Medeiros P, Messenger C, Phillipou A, Preston A, Prinjha RK, Rioja I, Satz AL, Taylor S, Wall ID, Watson RJ, Yao G, Demont EH.. (2021) Discovery of a Highly Selective BET BD2 Inhibitor from a DNA-Encoded Library Technology Screening Hit., 64 (15.0): [PMID:34251219 ] [10.1021/acs.jmedchem.1c00412 ]