(4-(3-(4-(1H-1,2,3-Triazol-1-yl)phenyl)-5-(piperidin-4-ylmethoxy)pyrazin-2-yl)phenyl)methanamine

ID: ALA4878457

PubChem CID: 164628334

Max Phase: Preclinical

Molecular Formula: C25H27N7O

Molecular Weight: 441.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(-c2ncc(OCC3CCNCC3)nc2-c2ccc(-n3ccnn3)cc2)cc1

Standard InChI:  InChI=1S/C25H27N7O/c26-15-18-1-3-20(4-2-18)24-25(21-5-7-22(8-6-21)32-14-13-29-31-32)30-23(16-28-24)33-17-19-9-11-27-12-10-19/h1-8,13-14,16,19,27H,9-12,15,17,26H2

Standard InChI Key:  HXGIUWBVVAWDHD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   17.6631  -18.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6620  -18.8926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3700  -19.3016    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0797  -18.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0769  -18.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3682  -17.6642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7880  -19.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4951  -18.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2034  -19.2974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9105  -18.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2047  -20.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6189  -19.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6201  -20.1124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9131  -20.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9558  -19.3009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9574  -17.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9585  -16.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2516  -16.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5430  -16.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5458  -17.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2533  -18.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8346  -16.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1276  -16.8492    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2520  -18.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5463  -19.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5464  -20.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2580  -20.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9608  -20.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8416  -20.5259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0944  -20.1951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5488  -20.8035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9589  -21.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7578  -21.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 11 14  1  0
 12 13  1  0
 13 14  1  0
  2 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
 19 22  1  0
 22 23  1  0
 15 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 15  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 29  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878457

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.54Molecular Weight (Monoisotopic): 441.2277AlogP: 3.23#Rotatable Bonds: 7
Polar Surface Area: 103.77Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.38CX LogP: 2.98CX LogD: -1.59
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -0.97

References

1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y..  (2021)  Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease.,  64  (5.0): [PMID:33596380] [10.1021/acs.jmedchem.0c02070]

Source