The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-acrylamidophenyl)-2-(4-phenoxyphenyl)-1H-imidazo[1,2-b]pyrazole-3-carboxamide ID: ALA4878459
PubChem CID: 164628335
Max Phase: Preclinical
Molecular Formula: C27H21N5O3
Molecular Weight: 463.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(-c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)[nH]c23)c1
Standard InChI: InChI=1S/C27H21N5O3/c1-2-23(33)30-19-8-6-7-18(15-19)22-16-29-32-25(26(28)34)24(31-27(22)32)17-11-13-21(14-12-17)35-20-9-4-3-5-10-20/h2-16,31H,1H2,(H2,28,34)(H,30,33)
Standard InChI Key: SAGAICSJEYDLRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
24.2798 -3.6111 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5359 -2.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8685 -2.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4529 -3.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1981 -2.8278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3741 -2.8293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1181 -3.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7864 -4.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7867 -4.9207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8669 -1.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1495 -1.0983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5787 -1.0957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3191 -2.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9338 -3.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7203 -2.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8931 -2.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2733 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4935 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6797 -1.8072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2953 -2.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1203 -3.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7309 -3.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5185 -3.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6921 -2.6520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0759 -2.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0736 -5.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0736 -6.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7866 -6.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5010 -6.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4976 -5.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2152 -6.5573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2184 -7.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9325 -7.7887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9358 -8.6115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5075 -7.7943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 1 0
2 3 2 0
3 5 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 2 0
8 9 1 0
3 10 1 0
10 11 2 0
10 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
9 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 9 1 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
32 35 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.50Molecular Weight (Monoisotopic): 463.1644AlogP: 5.01#Rotatable Bonds: 7Polar Surface Area: 114.51Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.89CX Basic pKa: ┄CX LogP: 4.34CX LogD: 4.34Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.95
References 1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q.. (2021) Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase., 225 [PMID:34391034 ] [10.1016/j.ejmech.2021.113724 ]