7-(3-acrylamidophenyl)-2-(4-phenoxyphenyl)-1H-imidazo[1,2-b]pyrazole-3-carboxamide

ID: ALA4878459

PubChem CID: 164628335

Max Phase: Preclinical

Molecular Formula: C27H21N5O3

Molecular Weight: 463.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cccc(-c2cnn3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)[nH]c23)c1

Standard InChI:  InChI=1S/C27H21N5O3/c1-2-23(33)30-19-8-6-7-18(15-19)22-16-29-32-25(26(28)34)24(31-27(22)32)17-11-13-21(14-12-17)35-20-9-4-3-5-10-20/h2-16,31H,1H2,(H2,28,34)(H,30,33)

Standard InChI Key:  SAGAICSJEYDLRC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   24.2798   -3.6111    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5359   -2.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8685   -2.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4529   -3.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1981   -2.8278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3741   -2.8293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1181   -3.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7864   -4.0982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7867   -4.9207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8669   -1.5126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1495   -1.0983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5787   -1.0957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3191   -2.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9338   -3.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7203   -2.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8931   -2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2733   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4935   -1.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6797   -1.8072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2953   -2.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1203   -3.1693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7309   -3.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5185   -3.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6921   -2.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0759   -2.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0736   -5.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0736   -6.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7866   -6.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5010   -6.1487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4976   -5.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2152   -6.5573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2184   -7.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9325   -7.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9358   -8.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5075   -7.7943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  2  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  8  9  1  0
  3 10  1  0
 10 11  2  0
 10 12  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  2 13  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  9 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30  9  1  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 32 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4878459

    ---

Associated Targets(Human)

BTK Tclin Tyrosine-protein kinase BTK (8973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.50Molecular Weight (Monoisotopic): 463.1644AlogP: 5.01#Rotatable Bonds: 7
Polar Surface Area: 114.51Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.89CX Basic pKa: CX LogP: 4.34CX LogD: 4.34
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.29Np Likeness Score: -0.95

References

1. Zhang D, Xu G, Zhao J, Wang Y, Wu X, He X, Li W, Zhang S, Yang S, Ma C, Jiang Y, Ding Q..  (2021)  Structure-activity relationship investigation for imidazopyrazole-3-carboxamide derivatives as novel selective inhibitors of Bruton's tyrosine kinase.,  225  [PMID:34391034] [10.1016/j.ejmech.2021.113724]

Source