The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(4-(4-(5-fluoro-2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-2-yl)cyclohex-3-enyl)piperidin-4-yl)acetic acid ID: ALA4878465
PubChem CID: 164628338
Max Phase: Preclinical
Molecular Formula: C26H28FN3O3
Molecular Weight: 449.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(F)cc1-c1ccnc2[nH]c(C3=CCC(N4CCC(C(=O)O)CC4)CC3)cc12
Standard InChI: InChI=1S/C26H28FN3O3/c1-33-24-7-4-18(27)14-21(24)20-8-11-28-25-22(20)15-23(29-25)16-2-5-19(6-3-16)30-12-9-17(10-13-30)26(31)32/h2,4,7-8,11,14-15,17,19H,3,5-6,9-10,12-13H2,1H3,(H,28,29)(H,31,32)
Standard InChI Key: GUVGQRABQXNJRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
14.4782 -1.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4771 -2.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1918 -2.9111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9083 -2.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9054 -1.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1900 -1.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6184 -1.2520 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7622 -2.9102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0480 -2.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1916 -3.7362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4773 -4.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4768 -4.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1916 -5.3834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9057 -4.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9130 -4.9622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6936 -5.2083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1689 -4.5418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6818 -3.8840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9938 -4.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4118 -5.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2332 -5.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6431 -4.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2254 -3.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3978 -3.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4681 -4.5250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8782 -5.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6996 -5.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1124 -4.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6973 -3.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8697 -3.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9373 -4.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3508 -5.2324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3489 -3.8033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
2 8 1 0
8 9 1 0
3 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 15 1 0
14 10 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
17 19 1 0
19 20 1 0
19 24 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 0
25 26 1 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
28 31 1 0
31 32 2 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 449.53Molecular Weight (Monoisotopic): 449.2115AlogP: 5.11#Rotatable Bonds: 5Polar Surface Area: 78.45Molecular Species: ZWITTERIONHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.24CX Basic pKa: 10.12CX LogP: 1.29CX LogD: 1.29Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.57Np Likeness Score: -0.12
References 1. Tong Y, Florjancic AS, Clark RF, Lai C, Mastracchio A, Zhu GD, Smith ML, Kovar PJ, Shaw B, Albert DH, Qiu W, Longenecker KL, Liu X, Olson AM, Osterling DJ, Tahir SK, Phillips DC, Leverson JD, Souers AJ, Penning TD.. (2021) Balancing Properties with Carboxylates: A Lead Optimization Campaign for Selective and Orally Active CDK9 Inhibitors., 12 (7.0): [PMID:34267880 ] [10.1021/acsmedchemlett.1c00161 ]