The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(3-(5-methyl-4-p-tolylthiazol-2-ylamino)benzamido)-3-phenylpropanoic acid ID: ALA4878516
PubChem CID: 164629203
Max Phase: Preclinical
Molecular Formula: C27H25N3O3S
Molecular Weight: 471.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2nc(Nc3cccc(C(=O)N[C@@H](Cc4ccccc4)C(=O)O)c3)sc2C)cc1
Standard InChI: InChI=1S/C27H25N3O3S/c1-17-11-13-20(14-12-17)24-18(2)34-27(30-24)28-22-10-6-9-21(16-22)25(31)29-23(26(32)33)15-19-7-4-3-5-8-19/h3-14,16,23H,15H2,1-2H3,(H,28,30)(H,29,31)(H,32,33)/t23-/m0/s1
Standard InChI Key: PGDLDFPDEVWSCO-QHCPKHFHSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
11.0884 -20.9498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0873 -21.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7953 -22.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5050 -21.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5022 -20.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7936 -20.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2134 -22.1763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9204 -21.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6657 -22.0925 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2115 -21.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8018 -20.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0028 -20.9485 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.0193 -21.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3521 -22.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1641 -22.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6443 -21.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3066 -20.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4955 -20.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1330 -20.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4572 -21.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7911 -19.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4976 -19.3130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0822 -19.3172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0798 -18.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3708 -18.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3684 -17.2768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6643 -18.5043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7862 -18.0894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7838 -17.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4896 -16.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4875 -16.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7780 -15.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0692 -16.0571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0748 -16.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 13 1 0
11 19 1 0
16 20 1 0
6 21 1 0
21 22 2 0
21 23 1 0
24 23 1 6
24 25 1 0
25 26 1 0
25 27 2 0
24 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.58Molecular Weight (Monoisotopic): 471.1617AlogP: 5.60#Rotatable Bonds: 8Polar Surface Area: 91.32Molecular Species: ACIDHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.20CX Basic pKa: 2.79CX LogP: 6.47CX LogD: 3.67Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.26
References 1. Zhang Y, Liu J, Wu X, Yang S, Li Y, Liu S, Zhu S, Cao X, Xie Z, Lei X, Huang H, Peng J.. (2021) Anti-chronic myeloid leukemia activity and quantitative structure-activity relationship of novel thiazole aminobenzamide derivatives., 44 [PMID:34015503 ] [10.1016/j.bmcl.2021.128116 ]