The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Methyl-N-(6-(1-(2-((4-methyl-3-(trifluoromethyl)phenyl)amino)-2-oxoethyl)-1H-pyrazol-4-yl)-1H-indazol-3-yl)-1H-pyrazole-4-carboxamide ID: ALA4878552
PubChem CID: 163215261
Max Phase: Preclinical
Molecular Formula: C25H21F3N8O2
Molecular Weight: 522.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)Cn2cc(-c3ccc4c(NC(=O)c5cnn(C)c5)n[nH]c4c3)cn2)cc1C(F)(F)F
Standard InChI: InChI=1S/C25H21F3N8O2/c1-14-3-5-18(8-20(14)25(26,27)28)31-22(37)13-36-12-16(9-30-36)15-4-6-19-21(7-15)33-34-23(19)32-24(38)17-10-29-35(2)11-17/h3-12H,13H2,1-2H3,(H,31,37)(H2,32,33,34,38)
Standard InChI Key: FBUQAQFCVKLDNZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
14.3377 -13.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0474 -12.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0446 -12.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3359 -11.7004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6297 -12.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6309 -12.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8547 -11.8587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3737 -12.5187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8527 -13.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5991 -13.9567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7507 -11.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4963 -12.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0408 -11.4162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6295 -10.7100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8309 -10.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8538 -11.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1890 -12.2439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0021 -12.3262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7112 -12.9068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3372 -13.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8559 -13.7325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1905 -14.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0044 -14.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4825 -13.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1453 -13.1502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7123 -15.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8994 -15.0572 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.0472 -15.8854 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.1268 -15.7165 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1450 -14.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8913 -15.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9446 -14.3961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1161 -15.5931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1149 -16.4103 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8917 -16.6639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3729 -16.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4530 -16.8896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3405 -15.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
3 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
15 11 1 0
13 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
10 30 1 0
30 31 1 0
30 32 2 0
31 33 2 0
33 34 1 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
23 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.49Molecular Weight (Monoisotopic): 522.1740AlogP: 4.38#Rotatable Bonds: 6Polar Surface Area: 122.52Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.94CX Basic pKa: 2.10CX LogP: 3.79CX LogD: 3.79Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -2.21
References 1. Wang XR, Wang S, Li WB, Xu KY, Qiao XP, Jing XL, Wang ZX, Yang CJ, Chen SW.. (2021) Design, synthesis and biological evaluation of novel 2-(4-(1H-indazol-6-yl)-1H-pyrazol-1-yl)acetamide derivatives as potent VEGFR-2 inhibitors., 213 [PMID:33493829 ] [10.1016/j.ejmech.2021.113192 ]