The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(1,3-di(9H-carbazol-9-yl)propan-2-yloxy)-2-hydroxypropyl)-N-hydroxypiperidine-4-carboxamide ID: ALA4878570
PubChem CID: 164626402
Max Phase: Preclinical
Molecular Formula: C36H38N4O4
Molecular Weight: 590.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NO)C1CCN(CC(O)COC(Cn2c3ccccc3c3ccccc32)Cn2c3ccccc3c3ccccc32)CC1
Standard InChI: InChI=1S/C36H38N4O4/c41-26(21-38-19-17-25(18-20-38)36(42)37-43)24-44-27(22-39-32-13-5-1-9-28(32)29-10-2-6-14-33(29)39)23-40-34-15-7-3-11-30(34)31-12-4-8-16-35(31)40/h1-16,25-27,41,43H,17-24H2,(H,37,42)
Standard InChI Key: OCVYWWSLZGQEHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
12.3837 -9.9328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5584 -9.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3061 -9.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5031 -8.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9516 -9.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2086 -10.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0110 -10.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9710 -8.6615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6391 -9.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3928 -8.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4797 -7.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8067 -7.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0557 -7.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8685 -10.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5325 -11.3545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0174 -12.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7118 -11.4405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8383 -11.9364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2505 -11.2164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0551 -11.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6042 -10.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3499 -9.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5414 -9.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9958 -10.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1437 -12.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3882 -12.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2993 -13.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9649 -13.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7217 -13.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8070 -12.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3758 -12.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5550 -12.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2190 -13.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0701 -11.6124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3982 -13.1201 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9190 -12.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1016 -12.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7616 -13.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2454 -13.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0692 -13.8740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9376 -13.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4552 -12.7019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5988 -14.1241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6342 -12.7847 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 9 1 0
8 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
16 18 1 0
18 26 1 0
25 20 1 0
19 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
17 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
33 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
41 42 1 0
41 43 2 0
38 41 1 0
42 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.72Molecular Weight (Monoisotopic): 590.2893AlogP: 5.57#Rotatable Bonds: 10Polar Surface Area: 91.89Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.08CX Basic pKa: 8.45CX LogP: 4.60CX LogD: 3.84Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.14Np Likeness Score: -0.50
References 1. Peng X, Sun Z, Kuang P, Chen J.. (2020) Recent progress on HDAC inhibitors with dual targeting capabilities for cancer treatment., 208 [PMID:32961382 ] [10.1016/j.ejmech.2020.112831 ]