4-(2-(4-(4-(1-(6,7,10-trioxaspiro[4.5]decan-8-yl)vinyl)phenoxy)phenoxy)ethoxy)-4-oxobutanoic acid

ID: ALA4878584

PubChem CID: 44232809

Max Phase: Preclinical

Molecular Formula: C27H30O9

Molecular Weight: 498.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2ccc(OCCOC(=O)CCC(=O)O)cc2)cc1)C1COC2(CCCC2)OO1

Standard InChI:  InChI=1S/C27H30O9/c1-19(24-18-33-27(36-35-24)14-2-3-15-27)20-4-6-22(7-5-20)34-23-10-8-21(9-11-23)31-16-17-32-26(30)13-12-25(28)29/h4-11,24H,1-3,12-18H2,(H,28,29)

Standard InChI Key:  RVIQDKQNYYLFAU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   42.8739  -18.0454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6622  -18.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1060  -17.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5919  -16.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8305  -17.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9225  -17.6662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6327  -18.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6331  -18.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3424  -19.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0486  -18.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0410  -18.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3311  -17.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7593  -19.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7654  -20.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4640  -18.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1712  -19.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8738  -18.8636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1614  -17.6406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4526  -18.0526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2173  -18.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8101  -18.9013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5252  -19.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2270  -18.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8055  -18.0832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5119  -17.6739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1054  -19.3151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3947  -18.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6900  -19.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9793  -18.9223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2746  -19.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5639  -18.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2807  -20.1533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5579  -18.1156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2625  -17.7018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9732  -18.1051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2565  -16.8846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 15 19  1  0
 16 17  1  0
 17  1  1  0
  1 18  1  0
 18 19  1  0
  6 20  1  0
 20 25  2  0
 24 21  2  0
 21 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  1  0
 21 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.53Molecular Weight (Monoisotopic): 498.1890AlogP: 4.90#Rotatable Bonds: 11
Polar Surface Area: 109.75Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.69CX Basic pKa: CX LogP: 4.71CX LogD: 1.40
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: 0.26

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source