The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(1-methyl-1H-pyrazol-4-yl)benzyl)-6-(7-(2-(4-(oxetan-3-yl)piperazin-1-yl)ethyl)imidazo[1,2-a]pyridin-3-yl)pyrimidin-4-amine ID: ALA4878590
PubChem CID: 155587716
Max Phase: Preclinical
Molecular Formula: C31H35N9O
Molecular Weight: 549.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(-c2ccc(CNc3cc(-c4cnc5cc(CCN6CCN(C7COC7)CC6)ccn45)ncn3)cc2)cn1
Standard InChI: InChI=1S/C31H35N9O/c1-37-19-26(17-36-37)25-4-2-24(3-5-25)16-32-30-15-28(34-22-35-30)29-18-33-31-14-23(7-9-40(29)31)6-8-38-10-12-39(13-11-38)27-20-41-21-27/h2-5,7,9,14-15,17-19,22,27H,6,8,10-13,16,20-21H2,1H3,(H,32,34,35)
Standard InChI Key: FGAGVPNKOYGOFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 47 0 0 0 0 0 0 0 0999 V2000
3.1078 -23.0258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1078 -23.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8131 -24.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8131 -22.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5307 -23.0877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5228 -23.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2980 -24.0867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7728 -23.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2908 -22.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5083 -21.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3009 -21.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5195 -20.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9464 -20.4098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1518 -20.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9370 -21.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3107 -20.7895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8832 -21.3726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6745 -21.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2436 -21.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0342 -21.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2537 -20.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6764 -20.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8879 -20.3814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0417 -20.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6727 -21.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3616 -20.6366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1563 -19.8456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3406 -19.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1221 -20.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4007 -24.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6924 -23.8451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9853 -24.2547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2817 -23.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4269 -24.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4321 -25.0675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2818 -25.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9930 -25.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1350 -25.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9311 -25.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1387 -26.0546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3509 -26.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
9 10 1 0
12 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
21 24 1 0
26 29 1 0
2 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 38 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.68Molecular Weight (Monoisotopic): 549.2965AlogP: 3.36#Rotatable Bonds: 9Polar Surface Area: 88.64Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.56CX LogP: 2.57CX LogD: 2.19Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -1.45