The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(1-acryloylpiperidin-2-yl)-1-amino-4-(4-((4-(4-chlorophenyl)pyridin-2-yl)carbamoyl)phenyl)-1H-imidazole-5-carboxamide ID: ALA4878626
PubChem CID: 155307326
Max Phase: Preclinical
Molecular Formula: C30H28ClN7O3
Molecular Weight: 570.05
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCCC[C@H]1c1nc(-c2ccc(C(=O)Nc3cc(-c4ccc(Cl)cc4)ccn3)cc2)c(C(N)=O)n1N
Standard InChI: InChI=1S/C30H28ClN7O3/c1-2-25(39)37-16-4-3-5-23(37)29-36-26(27(28(32)40)38(29)33)19-6-8-20(9-7-19)30(41)35-24-17-21(14-15-34-24)18-10-12-22(31)13-11-18/h2,6-15,17,23H,1,3-5,16,33H2,(H2,32,40)(H,34,35,41)/t23-/m0/s1
Standard InChI Key: DBNDRMANPSPBJX-QHCPKHFHSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
11.6237 -30.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4455 -30.7560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6171 -29.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8979 -29.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2847 -30.0912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3707 -29.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0410 -30.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7963 -29.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8830 -28.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2082 -28.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4557 -28.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6362 -28.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7644 -27.8001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2734 -29.1303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0431 -28.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6856 -29.3618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4560 -29.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5821 -28.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9357 -27.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1718 -28.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4779 -29.9187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8109 -28.7139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4784 -28.2278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0576 -28.3763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4501 -32.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8596 -32.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6863 -32.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8606 -31.5575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6259 -32.2727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2096 -31.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3864 -31.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9732 -32.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3852 -32.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2146 -32.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0586 -26.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8226 -26.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9456 -25.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3026 -25.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5342 -25.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4148 -26.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4243 -24.4795 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 6 1 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
4 22 1 0
22 23 1 0
22 24 2 0
30 1 1 1
29 25 1 0
25 26 1 0
26 27 2 0
25 28 2 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
19 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.05Molecular Weight (Monoisotopic): 569.1942AlogP: 4.57#Rotatable Bonds: 7Polar Surface Area: 149.23Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.95CX LogP: 4.12CX LogD: 4.12Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: -1.02
References 1. Ma C, Li Q, Zhao M, Fan G, Zhao J, Zhang D, Yang S, Zhang S, Gao D, Mao L, Zhu L, Li W, Xu G, Jiang Y, Ding Q.. (2021) Discovery of 1-Amino-1H -imidazole-5-carboxamide Derivatives as Highly Selective, Covalent Bruton's Tyrosine Kinase (BTK) Inhibitors., 64 (21.0): [PMID:34672559 ] [10.1021/acs.jmedchem.1c01559 ]