4-(1-(3-(2-(2-oxoimidazolidin-1-yl)ethoxy)-4-(4-phenethylthiazol-2-yl)phenyl)-1H-1,2,3-triazol-4-yl)butanoic acid

ID: ALA4878679

PubChem CID: 164628071

Max Phase: Preclinical

Molecular Formula: C28H30N6O4S

Molecular Weight: 546.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CCCc1cn(-c2ccc(-c3nc(CCc4ccccc4)cs3)c(OCCN3CCNC3=O)c2)nn1

Standard InChI:  InChI=1S/C28H30N6O4S/c35-26(36)8-4-7-21-18-34(32-31-21)23-11-12-24(25(17-23)38-16-15-33-14-13-29-28(33)37)27-30-22(19-39-27)10-9-20-5-2-1-3-6-20/h1-3,5-6,11-12,17-19H,4,7-10,13-16H2,(H,29,37)(H,35,36)

Standard InChI Key:  VMFNSKLJJUTIMP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   26.9937   -2.9924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6608   -3.4748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3273   -2.9855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0683   -2.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2442   -2.2078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6651   -4.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9546   -4.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9585   -5.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6720   -5.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3872   -5.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3799   -4.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6802   -6.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0192   -7.2602    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.2779   -8.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1029   -8.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3514   -7.2517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5498   -1.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3709   -1.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8483   -0.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6694   -1.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1058   -5.9326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.8172   -5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5357   -5.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2472   -5.4997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0043   -5.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5483   -5.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1318   -4.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3263   -4.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7073   -4.1276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5938   -8.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2607   -9.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7516  -10.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4149  -10.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9051  -11.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5662  -10.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0542  -10.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7230  -11.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0095   -1.7661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1464   -0.3510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  2  6  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  2  0
  9 12  1  0
  4 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 28 29  2  0
 15 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 37  2  0
 36 35  2  0
 35 32  1  0
 36 37  1  0
 20 38  1  0
 20 39  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4878679

    ---

Associated Targets(non-human)

TRYR Trypanothione reductase (236 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.65Molecular Weight (Monoisotopic): 546.2049AlogP: 3.99#Rotatable Bonds: 13
Polar Surface Area: 122.47Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.66CX Basic pKa: 2.19CX LogP: 3.83CX LogD: 0.65
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.49

References

1. Revuelto A, de Lucio H, García-Soriano JC, Sánchez-Murcia PA, Gago F, Jiménez-Ruiz A, Camarasa MJ, Velázquez S..  (2021)  Efficient Dimerization Disruption of Leishmania infantum Trypanothione Reductase by Triazole-phenyl-thiazoles.,  64  (9.0): [PMID:33945281] [10.1021/acs.jmedchem.1c00206]

Source