7-(3,5-dimethylisoxazol-4-yl)-2-(4-methoxyphenethyl)-N-(2-morpholinoethyl)imidazo[1,2-a]pyridin-3-amine

ID: ALA4878741

PubChem CID: 146589040

Max Phase: Preclinical

Molecular Formula: C27H33N5O3

Molecular Weight: 475.59

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CCc2nc3cc(-c4c(C)noc4C)ccn3c2NCCN2CCOCC2)cc1

Standard InChI:  InChI=1S/C27H33N5O3/c1-19-26(20(2)35-30-19)22-10-12-32-25(18-22)29-24(9-6-21-4-7-23(33-3)8-5-21)27(32)28-11-13-31-14-16-34-17-15-31/h4-5,7-8,10,12,18,28H,6,9,11,13-17H2,1-3H3

Standard InChI Key:  SELCCBYYCQBITD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    6.2278  -13.2231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7791  -14.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7782  -15.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4864  -15.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4841  -13.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1928  -14.2691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1979  -15.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9780  -15.3359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4552  -14.6706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9698  -14.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0746  -15.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3283  -15.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7812  -15.7761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1895  -16.4840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9888  -16.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1587  -14.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5959  -16.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2723  -14.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6853  -15.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5025  -15.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9113  -16.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7277  -16.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1327  -15.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7153  -14.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9003  -14.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9499  -15.3481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3638  -16.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6823  -12.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8826  -12.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3371  -12.1744    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5374  -12.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5913  -11.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9919  -11.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2461  -10.9575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0457  -10.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  7  1  0
  6  5  1  0
  5  2  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 10  1  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 11  2  0
  3 11  1  0
 12 16  1  0
 15 17  1  0
  9 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
  1 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 31 33  1  0
 32 35  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878741

    ---

Associated Targets(Human)

CREBBP Tchem CREB-binding protein (1602 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.59Molecular Weight (Monoisotopic): 475.2583AlogP: 4.14#Rotatable Bonds: 9
Polar Surface Area: 77.06Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.27CX LogP: 2.72CX LogD: 2.47
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: -1.40

References

1. Muthengi A, Wimalasena VK, Yosief HO, Bikowitz MJ, Sigua LH, Wang T, Li D, Gaieb Z, Dhawan G, Liu S, Erickson J, Amaro RE, Schönbrunn E, Qi J, Zhang W..  (2021)  Development of Dimethylisoxazole-Attached Imidazo[1,2-a]pyridines as Potent and Selective CBP/P300 Inhibitors.,  64  (9.0): [PMID:33872011] [10.1021/acs.jmedchem.0c02232]

Source