2,3-Difluoro-N-(2-((2-oxo-2-(((S)-1-phenylethyl)amino)ethyl)thio)benzo[d]thiazol-6-yl)-4-(pentan-2-yloxy)benzamide

ID: ALA4878746

PubChem CID: 164628768

Max Phase: Preclinical

Molecular Formula: C29H29F2N3O3S2

Molecular Weight: 569.70

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)c(F)c1F

Standard InChI:  InChI=1S/C29H29F2N3O3S2/c1-4-8-17(2)37-23-14-12-21(26(30)27(23)31)28(36)33-20-11-13-22-24(15-20)39-29(34-22)38-16-25(35)32-18(3)19-9-6-5-7-10-19/h5-7,9-15,17-18H,4,8,16H2,1-3H3,(H,32,35)(H,33,36)/t17?,18-/m0/s1

Standard InChI Key:  WGJBJZDAAMFRHS-ZVAWYAOSSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    2.1489  -18.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1477  -19.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8558  -20.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5696  -19.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667  -18.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8540  -18.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8515  -17.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5622  -17.3154    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426  -17.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2752  -17.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9858  -17.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6989  -17.7218    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.4095  -17.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1577  -17.6379    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.4891  -16.4866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2920  -16.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6984  -17.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5161  -17.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9282  -16.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5127  -15.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6964  -15.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7496  -16.3148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1590  -17.0261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9803  -17.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3903  -17.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2108  -17.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6194  -17.0259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2055  -16.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3863  -16.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4407  -17.0238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2776  -18.5474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7513  -17.7385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8511  -17.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6683  -17.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4443  -18.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0787  -18.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8959  -18.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9747  -15.6104    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6116  -15.6031    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  6
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 10 31  2  0
 23 32  2  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 34 36  1  0
 36 37  1  0
 29 38  1  0
 28 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878746

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.70Molecular Weight (Monoisotopic): 569.1618AlogP: 7.36#Rotatable Bonds: 11
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.97CX Basic pKa: 1.07CX LogP: 7.11CX LogD: 7.11
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.18Np Likeness Score: -1.87

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source