3-(2-Chlorophenyl)-4-((3-fluorophenyhamino)-1H-pyrrole-2,5-dione

ID: ALA4878748

PubChem CID: 164628769

Max Phase: Preclinical

Molecular Formula: C16H10ClFN2O2

Molecular Weight: 316.72

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC(=O)C(c2ccccc2Cl)=C1Nc1cccc(F)c1

Standard InChI:  InChI=1S/C16H10ClFN2O2/c17-12-7-2-1-6-11(12)13-14(16(22)20-15(13)21)19-10-5-3-4-9(18)8-10/h1-8H,(H2,19,20,21,22)

Standard InChI Key:  IUENVVYTSBJEAP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   10.6101   -6.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4272   -6.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6816   -5.6608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0187   -5.1787    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3599   -5.6608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1856   -7.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3663   -7.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9412   -7.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3344   -8.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1569   -8.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5782   -7.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9068   -7.0992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7201   -7.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1253   -7.8053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9378   -7.8053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3449   -7.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9336   -6.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1224   -6.3972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4592   -5.4094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5826   -5.4086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3464   -8.5130    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.9745   -6.3988    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  6  1  1  0
  2 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  3 19  2  0
  5 20  2  0
 15 21  1  0
  7 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878748

    ---

Associated Targets(Human)

SLK Tchem Serine/threonine-protein kinase 2 (1640 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STK10 Tchem Serine/threonine-protein kinase 10 (2119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.72Molecular Weight (Monoisotopic): 316.0415AlogP: 2.96#Rotatable Bonds: 3
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.76CX Basic pKa: CX LogP: 2.69CX LogD: 2.69
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.86Np Likeness Score: -0.92

References

1. Serafim RAM, Sorrell FJ, Berger BT, Collins RJ, Vasconcelos SNS, Massirer KB, Knapp S, Bennett J, Fedorov O, Patel H, Zuercher WJ, Elkins JM..  (2021)  Discovery of a Potent Dual SLK/STK10 Inhibitor Based on a Maleimide Scaffold.,  64  (18.0): [PMID:34463505] [10.1021/acs.jmedchem.0c01579]

Source