3-methyl-N-(2-(2-oxo-2-((S)-1-phenylethylamino)ethylthio)benzo[d]thiazol-6-yl)-4-((S)-pentan-2-yloxy)benzamide

ID: ALA4878780

PubChem CID: 164629215

Max Phase: Preclinical

Molecular Formula: C30H33N3O3S2

Molecular Weight: 547.75

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC[C@H](C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)cc1C

Standard InChI:  InChI=1S/C30H33N3O3S2/c1-5-9-20(3)36-26-15-12-23(16-19(26)2)29(35)32-24-13-14-25-27(17-24)38-30(33-25)37-18-28(34)31-21(4)22-10-7-6-8-11-22/h6-8,10-17,20-21H,5,9,18H2,1-4H3,(H,31,34)(H,32,35)/t20-,21-/m0/s1

Standard InChI Key:  NJQONGHAIYGHFF-SFTDATJTSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.2900   -9.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0072   -9.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1074   -9.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8870  -10.7657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7481   -9.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7945   -8.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7494  -11.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9805   -9.9699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3516   -9.9677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9776   -8.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5145   -8.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8003   -9.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7557   -9.8613    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.0250   -9.2545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3395   -8.5416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6517   -7.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7519  -11.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8855   -8.5430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2991   -9.9448    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.5743   -9.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4302   -8.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2001   -7.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4679   -7.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8815   -9.9503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5896   -9.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1670   -9.5378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0851   -8.7143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1058   -7.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0230   -7.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7526   -9.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1669  -11.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1691  -12.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4545   -9.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2893   -7.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4537  -10.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2466   -8.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4578  -12.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2094   -9.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6 22  1  0
 30 20  1  0
  3 11  2  0
 38 14  1  0
 12 38  2  0
 17  7  2  0
 35 33  1  0
 15 30  1  0
 31 35  2  0
  8 12  1  0
 19  2  1  0
 13  1  1  0
 11 15  1  0
 24 25  1  0
  7 37  1  0
 33 26  1  0
 16 23  1  0
 10 20  1  0
 14 21  1  0
 36 16  1  0
 30  9  2  0
 32 31  1  0
 35 17  1  0
 26 24  1  0
 18  1  2  0
 21 29  1  1
  1  3  1  0
 38  6  1  0
 37 32  2  0
 24  4  2  0
 33  5  1  6
  6 10  2  0
 11 28  1  0
 27  2  2  0
  2 13  1  0
 28 34  2  0
 18 27  1  0
 34 18  1  0
 21 36  1  0
 25 19  1  0
 20  8  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4878780

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.75Molecular Weight (Monoisotopic): 547.1963AlogP: 7.39#Rotatable Bonds: 11
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.64CX Basic pKa: 1.07CX LogP: 7.34CX LogD: 7.34
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.93

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source