The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-(4-((6-butoxy-3-oxobenzofuran-2(3H)-ylidene)methyl)-2,6-dimethylphenoxy)-2-methylpropanoic acid ID: ALA4878808
PubChem CID: 151814363
Max Phase: Preclinical
Molecular Formula: C25H28O6
Molecular Weight: 424.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOc1ccc2c(c1)O/C(=C\c1cc(C)c(OC(C)(C)C(=O)O)c(C)c1)C2=O
Standard InChI: InChI=1S/C25H28O6/c1-6-7-10-29-18-8-9-19-20(14-18)30-21(22(19)26)13-17-11-15(2)23(16(3)12-17)31-25(4,5)24(27)28/h8-9,11-14H,6-7,10H2,1-5H3,(H,27,28)/b21-13-
Standard InChI Key: SBHBYDQTIOOFNY-BKUYFWCQSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
23.8678 -17.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1620 -17.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1610 -18.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2380 -19.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2369 -20.7416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9449 -21.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9431 -19.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5302 -19.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6517 -19.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6565 -20.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4366 -20.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9139 -20.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4288 -19.6610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7311 -20.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1355 -19.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6936 -21.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9526 -19.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3570 -18.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9441 -18.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1228 -18.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7221 -18.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7075 -17.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1741 -18.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3476 -17.4773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5683 -16.7607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3854 -16.7548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1546 -16.0560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8226 -19.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1148 -19.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4072 -19.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6994 -19.5143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 10 2 0
9 7 2 0
7 4 1 0
4 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
12 14 2 0
14 15 1 0
11 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
20 22 1 0
18 23 1 0
19 24 1 0
24 2 1 0
2 25 1 0
25 26 1 0
25 27 2 0
8 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.49Molecular Weight (Monoisotopic): 424.1886AlogP: 5.34#Rotatable Bonds: 8Polar Surface Area: 82.06Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.77CX Basic pKa: ┄CX LogP: 5.72CX LogD: 2.44Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -0.13
References 1. Li Z, Ren Q, Zhou Z, Cai Z, Wang B, Han J, Zhang L.. (2021) Discovery of the first-in-class dual PPARδ/γ partial agonist for the treatment of metabolic syndrome., 225 [PMID:34455359 ] [10.1016/j.ejmech.2021.113807 ]