NA

ID: ALA4878814

PubChem CID: 164626070

Max Phase: Preclinical

Molecular Formula: C22H24N2O4S4

Molecular Weight: 508.71

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(Cc1ccc(C(=O)O)cc1)C(=S)SSC(=S)N(CC)Cc1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C22H24N2O4S4/c1-3-23(13-15-5-9-17(10-6-15)19(25)26)21(29)31-32-22(30)24(4-2)14-16-7-11-18(12-8-16)20(27)28/h5-12H,3-4,13-14H2,1-2H3,(H,25,26)(H,27,28)

Standard InChI Key:  CZHUIHXXAJKBKY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    5.9824  -11.7493    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.6933  -11.3389    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.4083  -11.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1234  -11.3389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4083  -12.5743    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2674  -11.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5523  -11.7493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2674  -10.5139    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.8384  -11.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1234  -10.5139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8384  -10.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5534  -11.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8373  -11.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5523  -12.5743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1222  -11.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8373  -12.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5584  -10.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2730  -10.1019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2719   -9.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5502   -8.8627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8386   -9.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1224  -12.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4078  -12.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4089  -13.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1305  -14.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8421  -13.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9815   -8.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6936   -9.2700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9788   -8.0410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6993  -14.2259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9871  -13.8177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7019  -15.0467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  1  6  1  0
  6  7  1  0
  6  8  2  0
  4  9  1  0
  4 10  1  0
 10 11  1  0
  9 12  1  0
  7 13  1  0
  7 14  1  0
 13 15  1  0
 14 16  1  0
 11 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 11  1  0
 16 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 16  1  0
 19 27  1  0
 27 28  1  0
 27 29  2  0
 24 30  1  0
 30 31  1  0
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4878814

    ---

Associated Targets(Human)

ALDH1A1 Tchem Aldehyde dehydrogenase 1A1 (77053 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALDH2 Tclin Aldehyde dehydrogenase (509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.71Molecular Weight (Monoisotopic): 508.0619AlogP: 5.38#Rotatable Bonds: 8
Polar Surface Area: 81.08Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.76CX Basic pKa: CX LogP: 6.21CX LogD: -0.03
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -0.57

References

1. Omran Z..  (2021)  Development of new disulfiram analogues as ALDH1a1-selective inhibitors.,  40  [PMID:33744437] [10.1016/j.bmcl.2021.127958]

Source