(4-(5-(Benzyloxy)-3-(4-(furan-3-yl)phenyl)pyrazin-2-yl)phenyl)methanamine

ID: ALA4878816

PubChem CID: 155193935

Max Phase: Preclinical

Molecular Formula: C28H23N3O2

Molecular Weight: 433.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(-c2ncc(OCc3ccccc3)nc2-c2ccc(-c3ccoc3)cc2)cc1

Standard InChI:  InChI=1S/C28H23N3O2/c29-16-20-6-8-23(9-7-20)27-28(24-12-10-22(11-13-24)25-14-15-32-19-25)31-26(17-30-27)33-18-21-4-2-1-3-5-21/h1-15,17,19H,16,18,29H2

Standard InChI Key:  HCRZUVWLMJLNHA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   17.9066  -18.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9055  -19.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6135  -19.5162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3232  -19.1068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3204  -18.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6117  -17.8789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0315  -19.5143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1993  -19.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2009  -17.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2020  -17.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4951  -16.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7865  -17.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7893  -17.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4968  -18.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0781  -16.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3711  -17.0639    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4955  -19.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7898  -19.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7899  -20.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5016  -20.7367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2043  -20.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0810  -20.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3338  -20.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7882  -21.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1982  -21.7232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9972  -21.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7386  -19.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4470  -19.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4436  -20.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1511  -20.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8592  -20.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8553  -19.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1472  -19.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  2  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1  9  1  0
 12 15  1  0
 15 16  1  0
  8 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21  8  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 19 22  1  0
  7 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878816

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.51Molecular Weight (Monoisotopic): 433.1790AlogP: 6.11#Rotatable Bonds: 7
Polar Surface Area: 74.17Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.21CX LogP: 5.68CX LogD: 3.89
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -0.33

References

1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y..  (2021)  Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease.,  64  (5.0): [PMID:33596380] [10.1021/acs.jmedchem.0c02070]

Source