The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(3-(4-(Furan-3-yl)phenyl)-6-(2-(piperazin-1-yl)ethoxy)pyrazin-2-yl)phenyl)methanamine ID: ALA4878840
PubChem CID: 164626250
Max Phase: Preclinical
Molecular Formula: C27H29N5O2
Molecular Weight: 455.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCc1ccc(-c2nc(OCCN3CCNCC3)cnc2-c2ccc(-c3ccoc3)cc2)cc1
Standard InChI: InChI=1S/C27H29N5O2/c28-17-20-1-3-23(4-2-20)27-26(22-7-5-21(6-8-22)24-9-15-33-19-24)30-18-25(31-27)34-16-14-32-12-10-29-11-13-32/h1-9,15,18-19,29H,10-14,16-17,28H2
Standard InChI Key: HEVIKSSYJLTYMI-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
41.1512 -27.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1500 -28.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8581 -28.6291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.5677 -28.2197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5649 -27.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8563 -26.9918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2761 -28.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.9832 -28.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6915 -28.6250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4439 -28.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4454 -26.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4466 -26.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7396 -25.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0310 -26.1746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0339 -26.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7414 -27.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3227 -25.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7400 -28.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0344 -28.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0345 -29.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7461 -29.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4488 -29.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3986 -28.2153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.1069 -28.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3973 -27.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1044 -26.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.8127 -27.3958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.8140 -28.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3276 -29.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6190 -29.4452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2353 -24.9561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4357 -24.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0282 -25.4959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5760 -26.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
2 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
1 11 1 0
14 17 1 0
10 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 10 1 0
9 23 1 0
23 24 1 0
23 25 1 0
25 26 1 0
24 28 1 0
26 27 1 0
27 28 1 0
20 29 1 0
29 30 1 0
17 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 17 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.56Molecular Weight (Monoisotopic): 455.2321AlogP: 3.81#Rotatable Bonds: 8Polar Surface Area: 89.44Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.51CX LogP: 3.44CX LogD: -0.16Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -0.58
References 1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y.. (2021) Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease., 64 (5.0): [PMID:33596380 ] [10.1021/acs.jmedchem.0c02070 ]