(4-(3-(4-(Furan-3-yl)phenyl)-6-(2-(piperazin-1-yl)ethoxy)pyrazin-2-yl)phenyl)methanamine

ID: ALA4878840

PubChem CID: 164626250

Max Phase: Preclinical

Molecular Formula: C27H29N5O2

Molecular Weight: 455.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCc1ccc(-c2nc(OCCN3CCNCC3)cnc2-c2ccc(-c3ccoc3)cc2)cc1

Standard InChI:  InChI=1S/C27H29N5O2/c28-17-20-1-3-23(4-2-20)27-26(22-7-5-21(6-8-22)24-9-15-33-19-24)30-18-25(31-27)34-16-14-32-12-10-29-11-13-32/h1-9,15,18-19,29H,10-14,16-17,28H2

Standard InChI Key:  HEVIKSSYJLTYMI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   41.1512  -27.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1500  -28.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8581  -28.6291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5677  -28.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5649  -27.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8563  -26.9918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2761  -28.6272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.9832  -28.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6915  -28.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4439  -28.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4454  -26.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4466  -26.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7396  -25.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0310  -26.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0339  -26.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7414  -27.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3227  -25.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7400  -28.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0344  -28.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0345  -29.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7461  -29.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4488  -29.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3986  -28.2153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.1069  -28.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3973  -27.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1044  -26.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8127  -27.3958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.8140  -28.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3276  -29.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6190  -29.4452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2353  -24.9561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4357  -24.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0282  -25.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5760  -26.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  2 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  1 11  1  0
 14 17  1  0
 10 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 10  1  0
  9 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 24 28  1  0
 26 27  1  0
 27 28  1  0
 20 29  1  0
 29 30  1  0
 17 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 17  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4878840

    ---

Associated Targets(non-human)

NS3 Genome polyprotein (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.56Molecular Weight (Monoisotopic): 455.2321AlogP: 3.81#Rotatable Bonds: 8
Polar Surface Area: 89.44Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.51CX LogP: 3.44CX LogD: -0.16
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -0.58

References

1. Nie S, Yao Y, Wu F, Wu X, Zhao J, Hua Y, Wu J, Huo T, Lin YL, Kneubehl AR, Vogt MB, Ferreon J, Rico-Hesse R, Song Y..  (2021)  Synthesis, Structure-Activity Relationships, and Antiviral Activity of Allosteric Inhibitors of Flavivirus NS2B-NS3 Protease.,  64  (5.0): [PMID:33596380] [10.1021/acs.jmedchem.0c02070]

Source