2-(2-chlorophenyl)-N-((2-(4-methylpiperidin-1-yl)-6-(trifluoromethyl)pyridin-3-yl)methyl)propanamide

ID: ALA4878850

PubChem CID: 164626413

Max Phase: Preclinical

Molecular Formula: C22H25ClF3N3O

Molecular Weight: 439.91

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CCN(c2nc(C(F)(F)F)ccc2CNC(=O)C(C)c2ccccc2Cl)CC1

Standard InChI:  InChI=1S/C22H25ClF3N3O/c1-14-9-11-29(12-10-14)20-16(7-8-19(28-20)22(24,25)26)13-27-21(30)15(2)17-5-3-4-6-18(17)23/h3-8,14-15H,9-13H2,1-2H3,(H,27,30)

Standard InChI Key:  SSYYHFMSWWIADT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   27.2477   -1.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2465   -2.8148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.9614   -3.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6777   -2.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6749   -1.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9596   -1.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9612   -4.0525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2453   -4.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2431   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9556   -5.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6720   -5.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6759   -4.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9523   -6.5215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3929   -3.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1066   -2.8120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.8218   -3.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5356   -2.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8231   -4.0484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2506   -3.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2475   -4.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9617   -4.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6765   -4.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6725   -3.2151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9577   -2.8076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9532   -1.9827    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.5343   -1.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5332   -1.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5330   -0.7501    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.8188   -1.9878    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.8158   -1.1625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 10 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
 17 26  1  0
  1 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878850

    ---

Associated Targets(Human)

TRPV1 Tclin Vanilloid receptor (8273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.91Molecular Weight (Monoisotopic): 439.1638AlogP: 5.41#Rotatable Bonds: 5
Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.51CX LogP: 5.79CX LogD: 5.79
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -1.55

References

1. Kang JM, Kwon SO, Ann J, Lee S, Kim C, Do N, Jeong JJ, Blumberg PM, Ha H, Vu TNL, Yoon S, Choi S, Frank-Foltyn R, Lesch B, Bahrenberg G, Stockhausen H, Christoph T, Lee J..  (2021)  2-(Halogenated Phenyl) acetamides and propanamides as potent TRPV1 antagonists.,  48  [PMID:34273488] [10.1016/j.bmcl.2021.128266]

Source