The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-(4-chlorophenyl)-2,4-dioxo-cyclopentyl]-N-hydroxy-heptanamide ID: ALA4878864
PubChem CID: 164626689
Max Phase: Preclinical
Molecular Formula: C18H22ClNO4
Molecular Weight: 351.83
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(=O)N(O)C1CC(=O)C(c2ccc(Cl)cc2)C1=O
Standard InChI: InChI=1S/C18H22ClNO4/c1-2-3-4-5-6-16(22)20(24)14-11-15(21)17(18(14)23)12-7-9-13(19)10-8-12/h7-10,14,17,24H,2-6,11H2,1H3
Standard InChI Key: QYQJYIXAKHPKTG-UHFFFAOYSA-N
Molfile:
RDKit 2D
24 25 0 0 0 0 0 0 0 0999 V2000
6.8500 -8.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6750 -8.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9319 -7.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2625 -7.3501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5975 -7.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2613 -6.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9768 -6.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9759 -5.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2603 -4.8757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5440 -5.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5485 -6.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2579 -4.0508 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.1592 -9.2889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7168 -7.5830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8128 -7.5823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8227 -10.0423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9798 -9.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4640 -9.8718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3162 -8.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1369 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4733 -7.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2938 -7.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6303 -6.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4509 -6.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
4 6 1 0
9 12 1 0
2 13 1 0
3 14 2 0
5 15 2 0
13 16 1 0
13 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 351.83Molecular Weight (Monoisotopic): 351.1237AlogP: 3.52#Rotatable Bonds: 7Polar Surface Area: 74.68Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.66CX Basic pKa: ┄CX LogP: 4.13CX LogD: 3.93Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.35Np Likeness Score: -0.18
References 1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K.. (2020) Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?, 11 (4.0): [PMID:33479649 ] [10.1039/D0MD00062K ]