6-(((4-(tert-Butoxy)pyrimidin-5-yl)methyl)amino)-4-(((cis)-4-hydroxycyclohexyl)amino)nicotinonitrile

ID: ALA4878871

PubChem CID: 164626907

Max Phase: Preclinical

Molecular Formula: C21H28N6O2

Molecular Weight: 396.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)Oc1ncncc1CNc1cc(N[C@H]2CC[C@@H](O)CC2)c(C#N)cn1

Standard InChI:  InChI=1S/C21H28N6O2/c1-21(2,3)29-20-15(10-23-13-26-20)12-25-19-8-18(14(9-22)11-24-19)27-16-4-6-17(28)7-5-16/h8,10-11,13,16-17,28H,4-7,12H2,1-3H3,(H2,24,25,27)/t16-,17+

Standard InChI Key:  YTCNCUIPQVXVOR-CALCHBBNSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   15.8747   -9.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2914  -10.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7036   -9.6719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9989  -10.4145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2849  -10.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5693  -10.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8531  -10.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8506  -11.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5639  -12.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2801  -11.6541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7151  -10.0062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5741   -9.5797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2960   -9.1644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0116   -9.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7278   -9.1663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7263   -8.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0170   -7.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3008   -8.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4466   -7.9330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1344  -12.0585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.4252  -11.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7090  -12.0471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6998  -12.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9795  -13.2832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2703  -12.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2782  -12.0367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9966  -11.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0052  -10.8098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5763  -10.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  3  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 13 18  1  0
 16 19  1  1
 13 12  1  1
  6 12  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 20 21  1  0
  8 20  1  0
 28  2  1  0
 27 28  1  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878871

    ---

Associated Targets(Human)

PRKCQ Tchem Protein kinase C theta (3319 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCD Tclin Protein kinase C delta (2953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.50Molecular Weight (Monoisotopic): 396.2274AlogP: 3.25#Rotatable Bonds: 6
Polar Surface Area: 115.98Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.54CX LogP: 1.86CX LogD: 1.80
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -1.01

References

1. Papa P, Whitefield B, Mortensen DS, Cashion D, Huang D, Torres E, Parnes J, Sapienza J, Hansen J, Correa M, Delgado M, Harris R, Hegde S, Norris S, Bahmanyar S, Plantevin-Krenitsky V, Liu Z, Leftheris K, Kulkarni A, Bennett B, Hur EM, Ringheim G, Khambatta G, Chan H, Muir J, Blease K, Burnett K, LeBrun L, Morrison L, Celeridad M, Khattri R, Cathers BE..  (2021)  Discovery of the Selective Protein Kinase C-θ Kinase Inhibitor, CC-90005.,  64  (16.0): [PMID:34355886] [10.1021/acs.jmedchem.1c00388]

Source