2-(3-(cyclobutoxymethyl)-1,4'-bipiperidin-1'-yl)-N-((3,5-difluoropyridin-2-yl)methyl)thiazole-5-carboxamide

ID: ALA4878875

PubChem CID: 156735109

Max Phase: Preclinical

Molecular Formula: C25H33F2N5O2S

Molecular Weight: 505.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NCc1ncc(F)cc1F)c1cnc(N2CCC(N3CCCC(COC4CCC4)C3)CC2)s1

Standard InChI:  InChI=1S/C25H33F2N5O2S/c26-18-11-21(27)22(28-12-18)13-29-24(33)23-14-30-25(35-23)31-9-6-19(7-10-31)32-8-2-3-17(15-32)16-34-20-4-1-5-20/h11-12,14,17,19-20H,1-10,13,15-16H2,(H,29,33)

Standard InChI Key:  KMNWWCLNNWZFIT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    0.9974   -5.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9962   -6.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7043   -6.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4139   -6.2711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4111   -5.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7025   -5.0432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7000   -4.2260    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.2882   -6.6796    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1173   -5.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8265   -5.4431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5327   -5.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2419   -5.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5296   -4.2147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3282   -6.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1282   -6.4169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5342   -5.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9850   -5.1024    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3466   -5.6190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8298   -6.2823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6388   -6.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9723   -5.4496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4905   -4.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6751   -4.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7851   -5.3642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2621   -6.0305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0714   -5.9474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4078   -5.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9284   -4.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1127   -4.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2633   -3.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0763   -3.7111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4112   -2.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1771   -2.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8868   -1.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1229   -2.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  1  0
 16 18  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878875

    ---

Associated Targets(Human)

ADRA2C Tclin Alpha-2c adrenergic receptor (4876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.64Molecular Weight (Monoisotopic): 505.2323AlogP: 4.00#Rotatable Bonds: 8
Polar Surface Area: 70.59Molecular Species: BASEHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.88CX Basic pKa: 9.15CX LogP: 2.91CX LogD: 1.15
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.59Np Likeness Score: -1.50

References

1. Sabnis RW..  (2021)  Novel Substituted Heterocyclic Carboxamides as Adrenoreceptor ADRAC2 Inhibitors for Treating Diseases.,  12  (9.0): [PMID:34531943] [10.1021/acsmedchemlett.1c00423]

Source