(1'R,6R)-Spiro[penicillanic-6,1'-(2-benzoyl-3-benzyloxycarbonyl(cyclopent-3-enyl))]acid

ID: ALA4878900

PubChem CID: 164627524

Max Phase: Preclinical

Molecular Formula: C27H25NO7S

Molecular Weight: 507.56

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)S[C@H]2N(C(=O)C23CC=C(C(=O)OCc2ccccc2)C3C(=O)Oc2ccccc2)[C@H]1C(=O)O

Standard InChI:  InChI=1S/C27H25NO7S/c1-26(2)20(21(29)30)28-24(33)27(25(28)36-26)14-13-18(22(31)34-15-16-9-5-3-6-10-16)19(27)23(32)35-17-11-7-4-8-12-17/h3-13,19-20,25H,14-15H2,1-2H3,(H,29,30)/t19?,20-,25+,27?/m0/s1

Standard InChI Key:  YKMXFKSXCUKEMB-SEMIZYOMSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   28.2528   -4.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2485   -3.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4626   -3.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9811   -4.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4694   -5.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0650   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3526   -5.2123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0697   -5.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2568   -5.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0818   -4.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0863   -5.6330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8723   -5.8837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8649   -4.5489    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.0735   -3.9790    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.1322   -6.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5841   -7.2832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9402   -6.8329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6735   -6.2163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1561   -4.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7400   -3.6935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7473   -5.1223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9223   -5.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8820   -5.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0859   -5.4332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.8778   -6.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1613   -6.8835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5062   -4.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9164   -3.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5009   -2.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6751   -2.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2664   -3.7130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6843   -4.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4500   -6.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7339   -6.8729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7293   -7.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4466   -8.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1598   -7.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  7  6  1  0
  7  8  1  0
  1  9  1  0
  9 11  1  0
 10  1  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
  7 13  1  0
 13 10  1  0
 10 14  1  6
 12 15  1  6
 15 16  2  0
 15 17  1  0
  9 18  2  0
  4 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
  5 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 22 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 26 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878900

    ---

Associated Targets(Human)

TZM (838 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.56Molecular Weight (Monoisotopic): 507.1352AlogP: 3.42#Rotatable Bonds: 6
Polar Surface Area: 110.21Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.16CX Basic pKa: CX LogP: 3.98CX LogD: 0.53
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: 0.45

References

1. Alves NG, Bártolo I, Alves AJS, Fontinha D, Francisco D, Lopes SMM, Soares MIL, Simões CJV, Prudêncio M, Taveira N, Pinho E Melo TMVD..  (2021)  Synthesis and structure-activity relationships of new chiral spiro-β-lactams highly active against HIV-1 and Plasmodium.,  219  [PMID:33887681] [10.1016/j.ejmech.2021.113439]

Source