The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-15-beta-((cyclohexanecarbonyl)oxy)methyl-16-alpha-hydroxybeyeran-19-oic acid ID: ALA4878915
PubChem CID: 164627528
Max Phase: Preclinical
Molecular Formula: C28H44O5
Molecular Weight: 460.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@H]3[C@]4(C)CCC[C@@](C)(C(=O)O)[C@H]4CC[C@@]3(C1)[C@H](COC(=O)C1CCCCC1)[C@H]2O
Standard InChI: InChI=1S/C28H44O5/c1-25-14-10-21-26(2)12-7-13-27(3,24(31)32)20(26)11-15-28(21,17-25)19(22(25)29)16-33-23(30)18-8-5-4-6-9-18/h18-22,29H,4-17H2,1-3H3,(H,31,32)/t19-,20+,21+,22-,25+,26-,27-,28-/m1/s1
Standard InChI Key: SVFRYSSDVVRGGM-XQKUADHBSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
26.3519 -12.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9440 -13.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7612 -13.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6466 -11.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6466 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3519 -11.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0572 -11.5356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0537 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7557 -12.7621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4658 -12.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7627 -11.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4693 -11.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1812 -11.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1927 -10.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4861 -9.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7680 -10.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3534 -14.1727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5784 -13.4637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3400 -11.9401 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.7556 -11.9442 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.9056 -9.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0499 -10.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1713 -11.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8976 -10.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6882 -10.5237 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5548 -12.6721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3715 -12.6999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7559 -13.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5726 -13.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3235 -14.1145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9512 -14.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7643 -14.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2004 -13.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8174 -12.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9982 -12.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
1 3 1 0
4 5 1 0
4 6 1 0
5 1 1 0
1 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 1 0
3 17 1 0
3 18 2 0
8 19 1 1
11 20 1 1
14 21 1 1
7 22 1 6
12 23 1 0
14 24 1 0
23 24 1 0
24 25 1 6
23 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
29 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.66Molecular Weight (Monoisotopic): 460.3189AlogP: 5.58#Rotatable Bonds: 4Polar Surface Area: 83.83Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.58CX Basic pKa: ┄CX LogP: 5.46CX LogD: 2.72Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: 1.79
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]