The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-methoxy-2-methyl-5-(3-oxo-3-(10H-phenothiazin-10-yl)propyl)-5H-pyrido[4,3-b]indol-2-ium iodide ID: ALA4878924
PubChem CID: 164627534
Max Phase: Preclinical
Molecular Formula: C28H24IN3O2S
Molecular Weight: 466.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c1c[n+](C)ccc1n2CCC(=O)N1c2ccccc2Sc2ccccc21.[I-]
Standard InChI: InChI=1S/C28H24N3O2S.HI/c1-29-15-13-23-21(18-29)20-17-19(33-2)11-12-22(20)30(23)16-14-28(32)31-24-7-3-5-9-26(24)34-27-10-6-4-8-25(27)31;/h3-13,15,17-18H,14,16H2,1-2H3;1H/q+1;/p-1
Standard InChI Key: KVNGRUIHOVASGF-UHFFFAOYSA-M
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
43.9509 -2.6290 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
43.7110 -8.5145 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
43.7110 -6.8801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4163 -7.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4147 -8.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1189 -8.5155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8252 -8.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8228 -7.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1180 -6.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0057 -8.1100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0083 -7.2946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3045 -6.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5978 -7.2927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5992 -8.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3035 -8.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7096 -6.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4166 -5.6531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.0012 -5.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9997 -4.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2913 -4.4310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5431 -4.7690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9968 -4.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1997 -4.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9478 -5.1086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4991 -5.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2942 -5.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3979 -3.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1984 -3.6235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7407 -3.0140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4837 -2.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6793 -2.0751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1405 -2.6858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1489 -5.2804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6006 -4.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4192 -1.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11 3 1 0
10 2 1 0
2 5 1 0
4 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
3 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 28 1 0
27 22 1 0
21 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
24 33 1 0
33 34 1 0
31 35 1 0
M CHG 2 1 -1 31 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.59Molecular Weight (Monoisotopic): 466.1584AlogP: 5.85#Rotatable Bonds: 4Polar Surface Area: 38.35Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.88CX LogD: 0.88Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -0.68
References 1. Schwarthoff S, Tischer N, Sager H, Schätz B, Rohrbach MM, Raztsou I, Robaa D, Gaube F, Arndt HD, Winckler T.. (2021) Evaluation of γ-carboline-phenothiazine conjugates as simultaneous NMDA receptor blockers and cholinesterase inhibitors., 46 [PMID:34391122 ] [10.1016/j.bmc.2021.116355 ]