5-((4-(tert-Butyl)phenyl)sulfonyl)-2-(2,5-dimethoxyphenyl)-1-methyl-1H-imidazole

ID: ALA4878960

PubChem CID: 130471908

Max Phase: Preclinical

Molecular Formula: C22H26N2O4S

Molecular Weight: 414.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(OC)c(-c2ncc(S(=O)(=O)c3ccc(C(C)(C)C)cc3)n2C)c1

Standard InChI:  InChI=1S/C22H26N2O4S/c1-22(2,3)15-7-10-17(11-8-15)29(25,26)20-14-23-21(24(20)4)18-13-16(27-5)9-12-19(18)28-6/h7-14H,1-6H3

Standard InChI Key:  YMBFKDRMKPVFMS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   44.5287  -12.8976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8188  -12.4849    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.8178  -13.3045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5663  -10.9866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5652  -11.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2773  -12.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9911  -11.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9883  -10.9830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2756  -10.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6996  -12.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7863  -13.0321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.5901  -13.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9976  -12.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4456  -11.8819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.2771  -13.0406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5652  -13.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6183  -11.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2286  -11.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0505  -11.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4561  -11.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0446  -10.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2191  -10.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8130  -11.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4493   -9.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2706   -9.6339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0369   -8.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.8576   -8.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2731   -9.7565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.9796   -9.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  7 10  1  0
  6 15  1  0
 15 16  1  0
 14 17  1  0
 13  2  1  0
  2 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
  9 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878960

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.53Molecular Weight (Monoisotopic): 414.1613AlogP: 4.23#Rotatable Bonds: 5
Polar Surface Area: 70.42Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.79CX LogP: 4.38CX LogD: 4.38
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.62Np Likeness Score: -0.84

References

1. Li Y, Lin W, Wright WC, Chai SC, Wu J, Chen T..  (2021)  Building a Chemical Toolbox for Human Pregnane X Receptor Research: Discovery of Agonists, Inverse Agonists, and Antagonists Among Analogs Based on the Unique Chemical Scaffold of SPA70.,  64  (3.0): [PMID:33497575] [10.1021/acs.jmedchem.0c02201]

Source