The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5R,9R)-5-((3,5-bis(trifluoromethyl)phenyl)amino)-11-ethylidene-7-methyl-5,6,9,10-tetrahydro-5,9-methanocycloocta[b]pyridin-2(1H)-one ID: ALA4878978
PubChem CID: 164628587
Max Phase: Preclinical
Molecular Formula: C23H20F6N2O
Molecular Weight: 454.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1\[C@H]2C=C(C)C[C@]1(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(=O)[nH]c1C2
Standard InChI: InChI=1S/C23H20F6N2O/c1-3-17-13-6-12(2)11-21(17,18-4-5-20(32)30-19(18)7-13)31-16-9-14(22(24,25)26)8-15(10-16)23(27,28)29/h3-6,8-10,13,31H,7,11H2,1-2H3,(H,30,32)/b17-3+/t13-,21+/m0/s1
Standard InChI Key: PMMKNWUZLASFDZ-QPUXKKDASA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.8716 -8.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7848 -8.5905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9141 -7.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3211 -9.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4462 -8.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6606 -7.4937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4146 -9.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3962 -7.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4095 -8.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2903 -8.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8007 -7.6439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2135 -7.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1652 -8.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2803 -9.3203 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9041 -9.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0701 -7.7064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6222 -6.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0701 -9.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6122 -8.2318 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.9933 -9.7332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9896 -10.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7018 -10.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4169 -10.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4153 -9.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7024 -9.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7004 -11.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9847 -12.2083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1068 -12.5063 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4946 -11.5764 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.1293 -9.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8454 -9.7281 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7114 -8.5988 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.5371 -8.5988 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 4 1 0
6 3 1 0
7 2 1 0
8 12 2 0
9 5 1 0
10 13 1 0
11 1 1 0
12 11 1 0
13 7 2 0
1 14 1 1
15 4 2 0
16 10 2 0
17 12 1 0
18 15 1 0
5 19 1 6
5 8 1 0
3 9 1 0
6 10 1 0
14 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
22 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
24 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.41Molecular Weight (Monoisotopic): 454.1480AlogP: 6.19#Rotatable Bonds: 2Polar Surface Area: 44.89Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.06CX Basic pKa: 2.68CX LogP: 4.44CX LogD: 4.44Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: 0.46
References 1. Miao SX, Wan LX, He ZX, Zhou XL, Li X, Gao F.. (2021) Pd-Catalyzed Direct Diversification of Natural Anti-Alzheimer's Disease Drug: Synthesis and Biological Evaluation of N -Aryl Huperzine A Analogues., 84 (8.0): [PMID:34445873 ] [10.1021/acs.jnatprod.1c00600 ]