NA

ID: ALA4878999

PubChem CID: 164628784

Max Phase: Preclinical

Molecular Formula: C17H12BrN3O3S

Molecular Weight: 418.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CS/C(=N\N=C/c2cccc3c2OCO3)N1c1ccc(Br)cc1

Standard InChI:  InChI=1S/C17H12BrN3O3S/c18-12-4-6-13(7-5-12)21-15(22)9-25-17(21)20-19-8-11-2-1-3-14-16(11)24-10-23-14/h1-8H,9-10H2/b19-8-,20-17-

Standard InChI Key:  ONLJEJKAGBHMPF-WJBOYGGZSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    8.4771   -8.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1867   -8.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1839   -7.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4753   -6.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7690   -8.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7657   -7.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9881   -7.0301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5108   -7.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9935   -8.3512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4726   -6.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1790   -5.6393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8880   -6.0457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5944   -5.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3367   -5.9660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8815   -5.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4706   -4.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6719   -4.8231    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.5065   -6.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8982   -7.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0685   -8.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8467   -8.3611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4547   -7.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2812   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6945   -5.4398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0186   -9.1600    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  4 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 14 18  1  0
 15 24  2  0
 21 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4878999

    ---

Associated Targets(non-human)

Schistosoma mansoni (6170 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.27Molecular Weight (Monoisotopic): 416.9783AlogP: 3.65#Rotatable Bonds: 3
Polar Surface Area: 63.49Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 8.20CX Basic pKa: CX LogP: 3.75CX LogD: 3.69
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.56Np Likeness Score: -1.09

References

1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K..  (2020)  Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?,  11  (4.0): [PMID:33479649] [10.1039/D0MD00062K]

Source