The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4878999
PubChem CID: 164628784
Max Phase: Preclinical
Molecular Formula: C17H12BrN3O3S
Molecular Weight: 418.27
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CS/C(=N\N=C/c2cccc3c2OCO3)N1c1ccc(Br)cc1
Standard InChI: InChI=1S/C17H12BrN3O3S/c18-12-4-6-13(7-5-12)21-15(22)9-25-17(21)20-19-8-11-2-1-3-14-16(11)24-10-23-14/h1-8H,9-10H2/b19-8-,20-17-
Standard InChI Key: ONLJEJKAGBHMPF-WJBOYGGZSA-N
Molfile:
RDKit 2D
25 28 0 0 0 0 0 0 0 0999 V2000
8.4771 -8.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1867 -8.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1839 -7.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4753 -6.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7690 -8.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7657 -7.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9881 -7.0301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5108 -7.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9935 -8.3512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4726 -6.0502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1790 -5.6393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8880 -6.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5944 -5.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3367 -5.9660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8815 -5.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4706 -4.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6719 -4.8231 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.5065 -6.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8982 -7.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0685 -8.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8467 -8.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4547 -7.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2812 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6945 -5.4398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0186 -9.1600 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
4 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
14 18 1 0
15 24 2 0
21 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.27Molecular Weight (Monoisotopic): 416.9783AlogP: 3.65#Rotatable Bonds: 3Polar Surface Area: 63.49Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.20CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.69Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.56Np Likeness Score: -1.09
References 1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K.. (2020) Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?, 11 (4.0): [PMID:33479649 ] [10.1039/D0MD00062K ]