The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-ethoxybenzyl)-2-(1-(phenylsulfonyl)-1H-indol-4-yloxy)ethanamine ID: ALA4879036
PubChem CID: 164625863
Max Phase: Preclinical
Molecular Formula: C25H26N2O4S
Molecular Weight: 450.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(CNCCOc2cccc3c2ccn3S(=O)(=O)c2ccccc2)cc1
Standard InChI: InChI=1S/C25H26N2O4S/c1-2-30-21-13-11-20(12-14-21)19-26-16-18-31-25-10-6-9-24-23(25)15-17-27(24)32(28,29)22-7-4-3-5-8-22/h3-15,17,26H,2,16,18-19H2,1H3
Standard InChI Key: LBOPVBNPFMAZKR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.7990 -4.6968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0933 -4.2882 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.0923 -5.1037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7658 -1.6632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7647 -2.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1795 -1.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4709 -1.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1824 -2.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4756 -2.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6432 -3.6858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4536 -3.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7868 -3.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2960 -4.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0473 -3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2492 -3.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7001 -3.7762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9546 -4.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7521 -4.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8857 -1.2484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5949 -1.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3011 -1.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0104 -1.6490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7165 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4258 -1.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4260 -2.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1344 -2.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8415 -2.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8358 -1.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1268 -1.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5513 -2.8604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5555 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2653 -4.0826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 9 1 0
8 6 1 0
6 7 2 0
7 4 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
10 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
6 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.56Molecular Weight (Monoisotopic): 450.1613AlogP: 4.45#Rotatable Bonds: 10Polar Surface Area: 69.56Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.82CX LogP: 4.40CX LogD: 2.97Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.23
References 1. Wichur T, Godyń J, Góral I, Latacz G, Bucki A, Siwek A, Głuch-Lutwin M, Mordyl B, Śniecikowska J, Walczak M, Knez D, Jukič M, Sałat K, Gobec S, Kołaczkowski M, Malawska B, Brazzolotto X, Więckowska A.. (2021) Development and crystallography-aided SAR studies of multifunctional BuChE inhibitors and 5-HT6 R antagonists with β-amyloid anti-aggregation properties., 225 [PMID:34530376 ] [10.1016/j.ejmech.2021.113792 ]