7-Chloro-3-((4-hydroxy-1-(2-(4-(trifluoromethyl)phenyl)acetyl)piperidin-4-yl)methyl)quinazolin-4(3H)-one

ID: ALA4879049

PubChem CID: 164626254

Max Phase: Preclinical

Molecular Formula: C23H21ClF3N3O3

Molecular Weight: 479.89

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(C(F)(F)F)cc1)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1

Standard InChI:  InChI=1S/C23H21ClF3N3O3/c24-17-5-6-18-19(12-17)28-14-30(21(18)32)13-22(33)7-9-29(10-8-22)20(31)11-15-1-3-16(4-2-15)23(25,26)27/h1-6,12,14,33H,7-11,13H2

Standard InChI Key:  CSFFZKHZGKXOLD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -1.1438  -15.0513    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.4385  -14.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2712  -15.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2600  -13.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4487  -13.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9742  -13.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9738  -14.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6747  -15.0400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3806  -14.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3810  -13.8214    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6756  -13.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6749  -12.5946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0893  -13.4139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7964  -13.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7894  -14.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4924  -15.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2031  -14.6456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2063  -13.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4988  -13.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0034  -13.0297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9087  -15.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9043  -15.8752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6185  -14.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3241  -15.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3146  -15.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0193  -16.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7302  -15.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7319  -15.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0266  -14.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4362  -16.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4330  -17.1186    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.1456  -15.8956    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.1406  -16.7070    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 20  1  0
 17 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879049

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.89Molecular Weight (Monoisotopic): 479.1224AlogP: 3.66#Rotatable Bonds: 4
Polar Surface Area: 75.43Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 2.75CX LogD: 2.75
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.62Np Likeness Score: -1.16

References

1. Li P, Liu Y, Yang H, Liu HM..  (2021)  Design, synthesis, biological evaluation and structure-activity relationship study of quinazolin-4(3H)-one derivatives as novel USP7 inhibitors.,  216  [PMID:33684824] [10.1016/j.ejmech.2021.113291]

Source