The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-chloro-7-(2-fluorophenyl)-1-(2-isopropyl-4-methylpyridin-3-yl)-4-((S)-2-methyl-4-((2R,3S)-3-(piperidin-1-ylmethyl)oxirane-2-carbonyl)piperazin-1-yl)pyrido[2,3-d]pyrimidin-2(1H)-one ID: ALA4879059
PubChem CID: 156296447
Max Phase: Preclinical
Molecular Formula: C36H41ClFN7O3
Molecular Weight: 674.22
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccnc(C(C)C)c1-n1c(=O)nc(N2CCN(C(=O)[C@@H]3O[C@H]3CN3CCCCC3)C[C@@H]2C)c2cc(Cl)c(-c3ccccc3F)nc21
Standard InChI: InChI=1S/C36H41ClFN7O3/c1-21(2)29-31(22(3)12-13-39-29)45-34-25(18-26(37)30(40-34)24-10-6-7-11-27(24)38)33(41-36(45)47)44-17-16-43(19-23(44)4)35(46)32-28(48-32)20-42-14-8-5-9-15-42/h6-7,10-13,18,21,23,28,32H,5,8-9,14-17,19-20H2,1-4H3/t23-,28-,32+/m0/s1
Standard InChI Key: OJAFWZHRWAPFKD-WMVJKMFWSA-N
Molfile:
RDKit 2D
48 54 0 0 0 0 0 0 0 0999 V2000
6.7081 -9.4194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4245 -9.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4216 -8.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7063 -7.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9932 -9.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9974 -8.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2868 -7.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5676 -8.1719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5635 -8.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2786 -9.4188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8466 -9.4075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1346 -7.7604 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.1361 -9.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1360 -10.2427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8503 -10.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5651 -10.2403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5612 -9.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8463 -9.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8427 -8.1785 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2765 -10.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5589 -10.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5556 -11.4745 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2691 -11.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9875 -11.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9873 -10.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7584 -10.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5471 -9.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1733 -11.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7021 -10.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2948 -6.9383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0137 -6.5315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0210 -5.7102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3111 -5.2893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5922 -5.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5832 -6.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8657 -6.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3194 -4.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0380 -4.0591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6092 -4.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2057 -3.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7859 -4.0363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2148 -2.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5049 -2.0808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5169 -1.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8111 -0.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0898 -1.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0787 -2.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7889 -2.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
3 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 20 1 0
21 26 1 0
26 27 1 0
26 28 1 0
25 29 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
7 30 1 0
35 36 1 1
33 37 1 0
37 38 2 0
39 37 1 6
40 39 1 0
41 40 1 0
39 41 1 0
40 42 1 1
42 43 1 0
43 44 1 0
43 48 1 0
44 45 1 0
45 46 1 0
46 47 1 0
47 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 674.22Molecular Weight (Monoisotopic): 673.2943AlogP: 5.36#Rotatable Bonds: 7Polar Surface Area: 99.99Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.30CX LogP: 5.54CX LogD: 4.58Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.24Np Likeness Score: -0.94