N-(2,6-Diisopropylphenyl)-4-(6-(4-(4-methylpiperazin-1-yl)phenyl)thieno[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide

ID: ALA4879073

PubChem CID: 164626420

Max Phase: Preclinical

Molecular Formula: C34H43N7OS

Molecular Weight: 597.83

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)c1cccc(C(C)C)c1NC(=O)N1CCN(c2ncnc3sc(-c4ccc(N5CCN(C)CC5)cc4)cc23)CC1

Standard InChI:  InChI=1S/C34H43N7OS/c1-23(2)27-7-6-8-28(24(3)4)31(27)37-34(42)41-19-17-40(18-20-41)32-29-21-30(43-33(29)36-22-35-32)25-9-11-26(12-10-25)39-15-13-38(5)14-16-39/h6-12,21-24H,13-20H2,1-5H3,(H,37,42)

Standard InChI Key:  YVOMUIVDDXSSPB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
    2.6332  -12.4106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9274  -12.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9274  -13.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6368  -14.0532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3462  -13.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3462  -12.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6368  -14.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9229  -15.2817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9229  -16.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6349  -16.5158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3460  -16.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3460  -15.2795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1214  -15.0228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6040  -15.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1308  -16.3422    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.4222  -15.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8394  -16.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6600  -16.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0643  -15.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6462  -14.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8270  -14.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8814  -15.6584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2914  -16.3616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1050  -16.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5103  -15.6452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0958  -14.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2760  -14.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3275  -15.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6313  -11.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3381  -11.1832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9227  -11.1864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3363  -10.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0440   -9.9603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0425   -9.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3333   -8.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6242   -9.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6292   -9.9657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7514  -10.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7509  -11.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4594   -9.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9244  -10.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2138   -9.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5106  -11.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 12 11  2  0
 12  7  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 11 15  1  0
 14 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
  1 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 33 38  1  0
 38 39  1  0
 38 40  1  0
 37 41  1  0
 41 42  1  0
 41 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879073

    ---

Associated Targets(Human)

FLT4 Tclin Vascular endothelial growth factor receptor 3 (3216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-436 (532 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 597.83Molecular Weight (Monoisotopic): 597.3250AlogP: 6.71#Rotatable Bonds: 6
Polar Surface Area: 67.84Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.50CX Basic pKa: 7.84CX LogP: 7.07CX LogD: 6.49
Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -1.57

References

1. Li Y, Yang G, Zhang J, Tang P, Yang C, Wang G, Chen J, Liu J, Zhang L, Ouyang L..  (2021)  Discovery, Synthesis, and Evaluation of Highly Selective Vascular Endothelial Growth Factor Receptor 3 (VEGFR3) Inhibitor for the Potential Treatment of Metastatic Triple-Negative Breast Cancer.,  64  (16.0): [PMID:34351741] [10.1021/acs.jmedchem.1c00678]

Source