3-Butyl-2-methyl-1-octyl-1H-benzo[d]imidazol-3-ium bromide

ID: ALA4879097

PubChem CID: 164626697

Max Phase: Preclinical

Molecular Formula: C20H33BrN2

Molecular Weight: 301.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCn1c(C)[n+](CCCC)c2ccccc21.[Br-]

Standard InChI:  InChI=1S/C20H33N2.BrH/c1-4-6-8-9-10-13-17-22-18(3)21(16-7-5-2)19-14-11-12-15-20(19)22;/h11-12,14-15H,4-10,13,16-17H2,1-3H3;1H/q+1;/p-1

Standard InChI Key:  OMPHABNTSAZZNZ-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 23 23  0  0  0  0  0  0  0  0999 V2000
   15.9394   -9.6453    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   12.8068   -9.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7242  -10.7844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4671  -11.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0119  -10.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6033   -9.8022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8168  -10.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0685  -11.4572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5196  -12.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7189  -11.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0144  -11.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3045  -10.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5987  -11.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8888  -10.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1831  -11.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4773  -10.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674  -11.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0576  -10.7844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2001   -9.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9418   -9.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7507   -8.9685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0850   -8.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8981   -8.1389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  2  6  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  4 10  2  0
  5  7  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  3 11  1  0
  2 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  6 20  1  0
M  CHG  2   1  -1   6   1
M  END

Associated Targets(non-human)

Mycobacterium tuberculosis variant bovis BCG (1626 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 301.50Molecular Weight (Monoisotopic): 301.2638AlogP: 5.40#Rotatable Bonds: 10
Polar Surface Area: 8.81Molecular Species: HBA: 1HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 1.64CX LogD: 1.64
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.41Np Likeness Score: -0.36

References

1. Fridianto KT, Li M, Hards K, Negatu DA, Cook GM, Dick T, Lam Y, Go ML..  (2021)  Functionalized Dioxonaphthoimidazoliums: A Redox Cycling Chemotype with Potent Bactericidal Activities against Mycobacterium tuberculosis.,  64  (21.0): [PMID:34706190] [10.1021/acs.jmedchem.1c01383]

Source