N2-(5-(4-Aminophenyl)pyridin-2-yl)-5-chloro-N4-(3-(trifluoromethyl)phenyl)pyrimidine-2,4-diamine

ID: ALA4879107

PubChem CID: 156768815

Max Phase: Preclinical

Molecular Formula: C22H16ClF3N6

Molecular Weight: 456.86

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ccc(-c2ccc(Nc3ncc(Cl)c(Nc4cccc(C(F)(F)F)c4)n3)nc2)cc1

Standard InChI:  InChI=1S/C22H16ClF3N6/c23-18-12-29-21(32-20(18)30-17-3-1-2-15(10-17)22(24,25)26)31-19-9-6-14(11-28-19)13-4-7-16(27)8-5-13/h1-12H,27H2,(H2,28,29,30,31,32)

Standard InChI Key:  ACTYGNXJGLFMRG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   19.4444  -13.3403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4433  -14.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1582  -14.5808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8748  -14.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8720  -13.3367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1564  -12.9275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5850  -12.9214    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.5900  -14.5789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3040  -14.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0159  -14.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7294  -14.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7286  -13.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0082  -12.9267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2978  -13.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7283  -14.5799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0140  -14.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4445  -14.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4454  -15.4010    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.8512  -13.8571    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.2679  -14.5739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.0193  -13.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3058  -12.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5898  -13.3407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5919  -14.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3059  -14.5795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8771  -12.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8781  -12.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1640  -11.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4487  -12.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4517  -12.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1664  -13.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7333  -11.6925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  1  0
 15 16  1  0
 11 17  1  0
 17 18  1  0
 17 19  1  0
 17 20  1  0
 16 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 16  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 23 26  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879107

    ---

Associated Targets(Human)

CTSC Tchem Dipeptidyl peptidase I (1385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.86Molecular Weight (Monoisotopic): 456.1077AlogP: 6.28#Rotatable Bonds: 5
Polar Surface Area: 88.75Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.23CX Basic pKa: 3.93CX LogP: 5.88CX LogD: 5.88
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -1.46

References

1. Chen X, Yan Y, Zhang Z, Zhang F, Liu M, Du L, Zhang H, Shen X, Zhao D, Shi JB, Liu X..  (2021)  Discovery and In Vivo Anti-inflammatory Activity Evaluation of a Novel Non-peptidyl Non-covalent Cathepsin C Inhibitor.,  64  (16.0): [PMID:34374541] [10.1021/acs.jmedchem.1c00104]

Source