ethyl 4-(2-oxo-2-(pyridin-4-ylmethylamino)ethyl)benzoate

ID: ALA4879143

PubChem CID: 135222977

Max Phase: Preclinical

Molecular Formula: C17H18N2O3

Molecular Weight: 298.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(CC(=O)NCc2ccncc2)cc1

Standard InChI:  InChI=1S/C17H18N2O3/c1-2-22-17(21)15-5-3-13(4-6-15)11-16(20)19-12-14-7-9-18-10-8-14/h3-10H,2,11-12H2,1H3,(H,19,20)

Standard InChI Key:  UUTHVAWKHBCZGQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   10.6138   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6127   -4.3194    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3207   -4.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0304   -4.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0275   -3.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3189   -3.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7337   -3.0850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4430   -3.4909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1491   -3.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1460   -2.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8584   -3.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5645   -3.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2698   -3.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9755   -3.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9728   -2.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2586   -1.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5558   -2.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6784   -1.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3882   -2.2461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0938   -1.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8036   -2.2389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6743   -1.0240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 18 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4879143

    ---

Associated Targets(Human)

NAMPT Tchem Nicotinamide phosphoribosyltransferase (3221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 298.34Molecular Weight (Monoisotopic): 298.1317AlogP: 2.12#Rotatable Bonds: 6
Polar Surface Area: 68.29Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.02CX LogP: 1.89CX LogD: 1.89
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.83Np Likeness Score: -1.10

References

1. Pinkerton AB, Sessions EH, Hershberger P, Maloney PR, Peddibhotla S, Hopf M, Sergienko E, Ma CT, Smith LH, Jackson MR, Tanaka J, Tsuji T, Akiu M, Cohen SE, Nakamura T, Gardell SJ..  (2021)  Optimization of a urea-containing series of nicotinamide phosphoribosyltransferase (NAMPT) activators.,  41  [PMID:33798699] [10.1016/j.bmcl.2021.128007]

Source