(3R,3aR,6R,6aR)-3,6-bis(4-hydroxy-3,5-dimethoxyphenyl)tetrahydrofuro[3,4-c]furan-1,4-dione

ID: ALA4879152

PubChem CID: 11155045

Max Phase: Preclinical

Molecular Formula: C22H22O10

Molecular Weight: 446.41

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc([C@@H]2OC(=O)[C@@H]3[C@H]2C(=O)O[C@H]3c2cc(OC)c(O)c(OC)c2)cc(OC)c1O

Standard InChI:  InChI=1S/C22H22O10/c1-27-11-5-9(6-12(28-2)17(11)23)19-15-16(22(26)31-19)20(32-21(15)25)10-7-13(29-3)18(24)14(8-10)30-4/h5-8,15-16,19-20,23-24H,1-4H3/t15-,16-,19+,20+/m1/s1

Standard InChI Key:  SOYZXRMXOYGADU-YKCBXCCJSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   11.2402  -14.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5709  -13.9085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9059  -14.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9834  -15.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1585  -15.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9034  -15.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5709  -16.4490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2383  -15.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0214  -14.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6337  -14.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4181  -14.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5913  -13.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9740  -13.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1920  -13.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1226  -16.2178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5096  -15.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7256  -15.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5535  -16.7260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1714  -17.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9531  -17.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1211  -14.1406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0229  -16.2189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8043  -15.1793    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3293  -15.1752    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1439  -12.2727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9279  -12.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3759  -13.3789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7691  -16.9820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1128  -15.3659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2847  -14.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0027  -18.0866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2190  -18.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0302  -14.9945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8571  -15.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  1  0
  3  5  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  1  9  1  1
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  6 15  1  1
  3 21  2  0
  8 22  2  0
  4 23  1  1
  5 24  1  1
 13 25  1  0
 25 26  1  0
 12 27  1  0
 18 28  1  0
 17 29  1  0
 29 30  1  0
 19 31  1  0
 31 32  1  0
 11 33  1  0
 33 34  1  0
M  END

Associated Targets(non-human)

Schistosoma mansoni (6170 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.41Molecular Weight (Monoisotopic): 446.1213AlogP: 2.26#Rotatable Bonds: 6
Polar Surface Area: 129.98Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.00CX Basic pKa: CX LogP: 1.79CX LogD: 1.77
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: 0.73

References

1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K..  (2020)  Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?,  11  (4.0): [PMID:33479649] [10.1039/D0MD00062K]

Source