The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,3aR,6R,6aR)-3,6-bis(4-hydroxy-3,5-dimethoxyphenyl)tetrahydrofuro[3,4-c]furan-1,4-dione ID: ALA4879152
PubChem CID: 11155045
Max Phase: Preclinical
Molecular Formula: C22H22O10
Molecular Weight: 446.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2OC(=O)[C@@H]3[C@H]2C(=O)O[C@H]3c2cc(OC)c(O)c(OC)c2)cc(OC)c1O
Standard InChI: InChI=1S/C22H22O10/c1-27-11-5-9(6-12(28-2)17(11)23)19-15-16(22(26)31-19)20(32-21(15)25)10-7-13(29-3)18(24)14(8-10)30-4/h5-8,15-16,19-20,23-24H,1-4H3/t15-,16-,19+,20+/m1/s1
Standard InChI Key: SOYZXRMXOYGADU-YKCBXCCJSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
11.2402 -14.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5709 -13.9085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9059 -14.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9834 -15.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1585 -15.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9034 -15.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5709 -16.4490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2383 -15.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0214 -14.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6337 -14.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4181 -14.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5913 -13.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9740 -13.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1920 -13.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1226 -16.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5096 -15.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7256 -15.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5535 -16.7260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1714 -17.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9531 -17.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1211 -14.1406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0229 -16.2189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8043 -15.1793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.3293 -15.1752 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.1439 -12.2727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9279 -12.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3759 -13.3789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7691 -16.9820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1128 -15.3659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2847 -14.5591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0027 -18.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2190 -18.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0302 -14.9945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8571 -15.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 1 1 0
1 2 1 0
2 3 1 0
3 5 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 9 1 1
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
6 15 1 1
3 21 2 0
8 22 2 0
4 23 1 1
5 24 1 1
13 25 1 0
25 26 1 0
12 27 1 0
18 28 1 0
17 29 1 0
29 30 1 0
19 31 1 0
31 32 1 0
11 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.41Molecular Weight (Monoisotopic): 446.1213AlogP: 2.26#Rotatable Bonds: 6Polar Surface Area: 129.98Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.00CX Basic pKa: ┄CX LogP: 1.79CX LogD: 1.77Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: 0.73
References 1. Dziwornu GA, Attram HD, Gachuhi S, Chibale K.. (2020) Chemotherapy for human schistosomiasis: how far have we come? What's new? Where do we go from here?, 11 (4.0): [PMID:33479649 ] [10.1039/D0MD00062K ]