2-(2,4-dimethoxyphenyl)-3-hydroxy-9-(1-methylpiperidin-4-yl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one

ID: ALA4879180

PubChem CID: 164628372

Max Phase: Preclinical

Molecular Formula: C25H28N2O6

Molecular Weight: 452.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2oc3c4c(ccc3c(=O)c2O)OCN(C2CCN(C)CC2)C4)c(OC)c1

Standard InChI:  InChI=1S/C25H28N2O6/c1-26-10-8-15(9-11-26)27-13-19-20(32-14-27)7-6-18-22(28)23(29)25(33-24(18)19)17-5-4-16(30-2)12-21(17)31-3/h4-7,12,15,29H,8-11,13-14H2,1-3H3

Standard InChI Key:  YDSUHIWBZDOCDB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   22.9245   -6.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6393   -7.2158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3529   -5.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3518   -6.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0648   -7.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7835   -6.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7847   -5.9739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0672   -5.5563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0625   -8.0385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4969   -7.2169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4984   -5.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2122   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9273   -5.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9297   -4.7459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2111   -4.3319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4990   -4.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7844   -4.3321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7841   -3.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6446   -4.3342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3588   -4.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9256   -5.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6389   -5.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6396   -4.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9287   -4.3319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2154   -4.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2130   -5.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9343   -3.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6516   -3.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6555   -2.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9437   -1.8600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.2264   -2.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2209   -3.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9487   -1.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 21  1  2  0
  1  2  1  0
  2  4  2  0
  3 22  2  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  5  9  2  0
  6 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 11  1  0
 16 17  1  0
 17 18  1  0
 14 19  1  0
 19 20  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 24 27  1  0
 30 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879180

    ---

Associated Targets(Human)

RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.1947AlogP: 3.43#Rotatable Bonds: 4
Polar Surface Area: 84.61Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.01CX Basic pKa: 7.84CX LogP: 1.87CX LogD: 1.55
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.64Np Likeness Score: 0.11

References

1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P..  (2021)  Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment.,  64  (20.0): [PMID:34644502] [10.1021/acs.jmedchem.1c00087]

Source