The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-dimethoxyphenyl)-3-hydroxy-9-(1-methylpiperidin-4-yl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one ID: ALA4879180
PubChem CID: 164628372
Max Phase: Preclinical
Molecular Formula: C25H28N2O6
Molecular Weight: 452.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2oc3c4c(ccc3c(=O)c2O)OCN(C2CCN(C)CC2)C4)c(OC)c1
Standard InChI: InChI=1S/C25H28N2O6/c1-26-10-8-15(9-11-26)27-13-19-20(32-14-27)7-6-18-22(28)23(29)25(33-24(18)19)17-5-4-16(30-2)12-21(17)31-3/h4-7,12,15,29H,8-11,13-14H2,1-3H3
Standard InChI Key: YDSUHIWBZDOCDB-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
22.9245 -6.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6393 -7.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3529 -5.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3518 -6.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0648 -7.2134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7835 -6.8025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7847 -5.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0672 -5.5563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0625 -8.0385 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4969 -7.2169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4984 -5.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2122 -5.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9273 -5.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9297 -4.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2111 -4.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4990 -4.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7844 -4.3321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.7841 -3.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6446 -4.3342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3588 -4.7476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9256 -5.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6389 -5.5645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6396 -4.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9287 -4.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2154 -4.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2130 -5.5678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9343 -3.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6516 -3.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6555 -2.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9437 -1.8600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2264 -2.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2209 -3.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9487 -1.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 1 2 0
1 2 1 0
2 4 2 0
3 22 2 0
3 4 1 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
5 9 2 0
6 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 11 1 0
16 17 1 0
17 18 1 0
14 19 1 0
19 20 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
24 27 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.1947AlogP: 3.43#Rotatable Bonds: 4Polar Surface Area: 84.61Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.01CX Basic pKa: 7.84CX LogP: 1.87CX LogD: 1.55Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.64Np Likeness Score: 0.11
References 1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P.. (2021) Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment., 64 (20.0): [PMID:34644502 ] [10.1021/acs.jmedchem.1c00087 ]