The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((2S)-2-(2-(3-chloro-2-fluorophenyl)-1-hydroxy-4-methyl-1H-imidazole-5-carboxamido)-3-(4-fluorophenyl)propanamido)-1H-indole-2-carboxylic acid ID: ALA4879256
PubChem CID: 164626434
Max Phase: Preclinical
Molecular Formula: C29H22ClF2N5O5
Molecular Weight: 593.97
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(-c2cccc(Cl)c2F)n(O)c1C(=O)N[C@@H](Cc1ccc(F)cc1)C(=O)Nc1ccc2[nH]c(C(=O)O)cc2c1
Standard InChI: InChI=1S/C29H22ClF2N5O5/c1-14-25(37(42)26(33-14)19-3-2-4-20(30)24(19)32)28(39)36-22(11-15-5-7-17(31)8-6-15)27(38)34-18-9-10-21-16(12-18)13-23(35-21)29(40)41/h2-10,12-13,22,35,42H,11H2,1H3,(H,34,38)(H,36,39)(H,40,41)/t22-/m0/s1
Standard InChI Key: RXWYKBAYZKLNPD-QFIPXVFZSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
8.1017 -12.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8095 -11.9690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5172 -12.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5146 -13.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2215 -13.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2201 -11.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3940 -11.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6863 -12.3776 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9786 -11.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1017 -13.1947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3940 -11.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1017 -10.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8090 -11.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5162 -10.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5167 -9.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8040 -9.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0997 -9.9305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9786 -11.1518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2709 -12.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5230 -12.0495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9762 -12.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3848 -13.3646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1841 -13.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7911 -13.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1683 -12.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8367 -11.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0248 -11.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5435 -12.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8801 -13.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6910 -13.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3509 -11.2507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4021 -13.8136 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.0254 -13.9785 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.9276 -12.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9312 -13.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7121 -13.4442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1912 -12.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7063 -12.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0084 -12.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4201 -13.4809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4138 -12.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2238 -9.5192 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 35 2 0
34 6 2 0
6 3 1 0
1 7 1 0
7 8 1 0
8 9 1 0
1 10 2 0
7 11 1 1
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
9 18 2 0
9 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 2 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
21 25 1 0
20 31 1 0
29 32 1 0
30 33 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 2 0
38 34 1 0
37 39 1 0
39 40 2 0
39 41 1 0
15 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.97Molecular Weight (Monoisotopic): 593.1278AlogP: 5.19#Rotatable Bonds: 8Polar Surface Area: 149.34Molecular Species: ACIDHBA: 6HBD: 5#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.63CX Basic pKa: 2.35CX LogP: 3.85CX LogD: 0.69Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -1.17
References 1. Lei Y, Zhang B, Zhang Y, Dai X, Duan Y, Mao Q, Gao J, Yang Y, Bao Z, Fu X, Ping K, Yan C, Mou Y, Wang S.. (2021) Design, synthesis and biological evaluation of novel FXIa inhibitors with 2-phenyl-1H-imidazole-5-carboxamide moiety as P1 fragment., 220 [PMID:33894565 ] [10.1016/j.ejmech.2021.113437 ]