ethyl 4-(3-(1-(pyridin-4-yl)ethyl)ureido)benzoate

ID: ALA4879262

PubChem CID: 133588913

Max Phase: Preclinical

Molecular Formula: C17H19N3O3

Molecular Weight: 313.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1ccc(NC(=O)NC(C)c2ccncc2)cc1

Standard InChI:  InChI=1S/C17H19N3O3/c1-3-23-16(21)14-4-6-15(7-5-14)20-17(22)19-12(2)13-8-10-18-11-9-13/h4-12H,3H2,1-2H3,(H2,19,20,22)

Standard InChI Key:  AJHSCUBKTILWSO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   35.2597  -15.7211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9659  -15.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6751  -15.7158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.3813  -15.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0905  -15.7104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.7967  -15.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3782  -14.4873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5019  -15.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2076  -15.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2050  -14.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4908  -14.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7880  -14.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9106  -14.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6204  -14.4710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.3260  -14.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0358  -14.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9064  -13.2488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5517  -15.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8461  -15.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8487  -16.5404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5629  -16.9462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2657  -16.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9628  -14.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  4  7  2  0
  6  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  6  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 13 17  2  0
  1 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22  1  1  0
  2 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4879262

    ---

Associated Targets(Human)

NAMPT Tchem Nicotinamide phosphoribosyltransferase (3221 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 313.36Molecular Weight (Monoisotopic): 313.1426AlogP: 3.14#Rotatable Bonds: 5
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.75CX Basic pKa: 5.01CX LogP: 2.38CX LogD: 2.38
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.83Np Likeness Score: -1.47

References

1. Pinkerton AB, Sessions EH, Hershberger P, Maloney PR, Peddibhotla S, Hopf M, Sergienko E, Ma CT, Smith LH, Jackson MR, Tanaka J, Tsuji T, Akiu M, Cohen SE, Nakamura T, Gardell SJ..  (2021)  Optimization of a urea-containing series of nicotinamide phosphoribosyltransferase (NAMPT) activators.,  41  [PMID:33798699] [10.1016/j.bmcl.2021.128007]

Source